cis-4-(2-Oxo-piperidin-1-yl)-cyclohexanecarboxylic acid [5-(3,5-difluoro-phenyl)-pyridin-2-yl]-amide

ID: ALA3126041

PubChem CID: 46913706

Max Phase: Preclinical

Molecular Formula: C23H25F2N3O2

Molecular Weight: 413.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1CCCCN1[C@H]1CC[C@@H](C(=O)Nc2ccc(-c3cc(F)cc(F)c3)cn2)CC1

Standard InChI:  InChI=1S/C23H25F2N3O2/c24-18-11-17(12-19(25)13-18)16-6-9-21(26-14-16)27-23(30)15-4-7-20(8-5-15)28-10-2-1-3-22(28)29/h6,9,11-15,20H,1-5,7-8,10H2,(H,26,27,30)/t15-,20+

Standard InChI Key:  CUSVWNVJYBQYIM-GSXCWMCISA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   16.1241  -13.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5366  -14.1214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3616  -14.1214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7741  -13.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3616  -12.6938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5366  -12.6938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2950  -13.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8825  -14.1214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8825  -12.6938    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0575  -12.6938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6450  -11.9779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8201  -11.9779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4076  -12.6938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8201  -13.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6450  -13.4055    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5826  -12.6938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1701  -11.9779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3451  -11.9779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9326  -12.6938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3451  -13.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1701  -13.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9326  -14.1214    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.9326  -11.2621    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.5991  -13.4055    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0116  -14.1214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8366  -14.1214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2491  -13.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8366  -12.6938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0116  -12.6938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5991  -14.8373    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  1  0
  7  8  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 16 21  2  0
 20 22  1  0
 18 23  1  0
 13 16  1  0
  9 10  1  0
  7  9  1  0
  1  7  1  1
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 24 29  1  0
 25 30  2  0
  4 24  1  1
M  END

Associated Targets(Human)

NPY5R Tchem Neuropeptide Y receptor type 5 (1834 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 413.47Molecular Weight (Monoisotopic): 413.1915AlogP: 4.54#Rotatable Bonds: 4
Polar Surface Area: 62.30Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.05CX Basic pKa: 3.55CX LogP: 3.85CX LogD: 3.85
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.80Np Likeness Score: -1.35

References

1. Burns JF, Chen B, Chen CA, Doller D, Edelmenky E, Jiang Y, Peterson JM, Sabio M, Weiss J, White AD, Wu L, Bhardwaj R, Chandrasena G, Boyle NJ, Huang X..  (2014)  cis-1-Oxo-heterocyclyl-4-amido cyclohexane derivatives as NPY5 receptor antagonists.,  24  (6): [PMID:24582476] [10.1016/j.bmcl.2014.02.023]

Source