(1-(2-Fluoroethyl)piperidin-4-yl)methyl 8-amino-7-chloro-2,3-dihydrobenzo[b][1,4]dioxine-5-carboxylate

ID: ALA3126109

PubChem CID: 72545049

Max Phase: Preclinical

Molecular Formula: C17H22ClFN2O4

Molecular Weight: 372.82

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1c(Cl)cc(C(=O)OCC2CCN(CCF)CC2)c2c1OCCO2

Standard InChI:  InChI=1S/C17H22ClFN2O4/c18-13-9-12(15-16(14(13)20)24-8-7-23-15)17(22)25-10-11-1-4-21(5-2-11)6-3-19/h9,11H,1-8,10,20H2

Standard InChI Key:  PLPFOLRFOQREOM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
    3.6317  -12.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6306  -13.0184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3453  -13.4311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3435  -11.7783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0589  -12.1873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0623  -13.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7814  -13.4317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5018  -13.0145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4984  -12.1815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7746  -11.7656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3439  -14.2561    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9158  -13.4302    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.3411  -10.9533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0543  -10.5387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6254  -10.5430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7699  -10.9491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4831  -10.5345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2010  -10.9485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9121  -10.5374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9138   -9.7120    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1984   -9.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4810   -9.7123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6286   -9.3002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3428   -9.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0575   -9.3013    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  3 11  1  0
  2 12  1  0
  4 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
 24 25  1  0
M  END

Associated Targets(non-human)

Htr4 Serotonin 4 (5-HT4) receptor (653 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 372.82Molecular Weight (Monoisotopic): 372.1252AlogP: 2.53#Rotatable Bonds: 5
Polar Surface Area: 74.02Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.94CX LogP: 1.95CX LogD: 1.30
Aromatic Rings: 1Heavy Atoms: 25QED Weighted: 0.63Np Likeness Score: -0.93

References

1. Caillé F, Morley TJ, Tavares AA, Papin C, Twardy NM, Alagille D, Lee HS, Baldwin RM, Seibyl JP, Barret O, Tamagnan GD..  (2013)  Synthesis and biological evaluation of positron emission tomography radiotracers targeting serotonin 4 receptors in brain: [18F]MNI-698 and [18F]MNI-699.,  23  (23): [PMID:24157369] [10.1016/j.bmcl.2013.09.097]

Source