The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-4-(3-(4-(cyclopentyl(hydroxy)(phenyl)methyl)piperidin-1-yl)propoxy)benzonitrile ID: ALA3126187
PubChem CID: 49791890
Max Phase: Preclinical
Molecular Formula: C27H34N2O2
Molecular Weight: 418.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc(OCCCN2CCC([C@@](O)(c3ccccc3)C3CCCC3)CC2)cc1
Standard InChI: InChI=1S/C27H34N2O2/c28-21-22-11-13-26(14-12-22)31-20-6-17-29-18-15-25(16-19-29)27(30,24-9-4-5-10-24)23-7-2-1-3-8-23/h1-3,7-8,11-14,24-25,30H,4-6,9-10,15-20H2/t27-/m1/s1
Standard InChI Key: QBITUTDDFZQXDO-HHHXNRCGSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
16.1003 -2.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2831 -2.2328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8732 -2.9346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2760 -3.6449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0932 -3.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5076 -2.9428 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0561 -2.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6520 -2.2190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0660 -1.5163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6626 -0.8064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8446 -0.8007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4316 -1.5108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8373 -2.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3248 -2.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7360 -2.2396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5532 -2.2426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9644 -1.5364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7815 -1.5394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1839 -2.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0003 -2.2506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4123 -1.5438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0019 -0.8323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1869 -0.8324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2292 -1.5479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0464 -1.5498 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6454 -3.6322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8322 -3.7124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6572 -4.5107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3623 -4.9238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9730 -4.3809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2360 -2.9262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
3 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
6 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
24 25 3 0
21 24 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 26 1 0
7 26 1 0
7 31 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.58Molecular Weight (Monoisotopic): 418.2620AlogP: 5.12#Rotatable Bonds: 8Polar Surface Area: 56.49Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.70CX Basic pKa: 8.77CX LogP: 4.91CX LogD: 3.52Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.60Np Likeness Score: -0.96
References 1. He S, Senter TJ, Pollock J, Han C, Upadhyay SK, Purohit T, Gogliotti RD, Lindsley CW, Cierpicki T, Stauffer SR, Grembecka J.. (2014) High-affinity small-molecule inhibitors of the menin-mixed lineage leukemia (MLL) interaction closely mimic a natural protein-protein interaction., 57 (4): [PMID:24472025 ] [10.1021/jm401868d ]