The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((4-cyano-4-(pyridin-2-yl)piperidin-1-yl)methyl)-N-((1S,2S)-2-hydroxycyclohexyl)-1-methoxy-2-naphthamide ID: ALA3126676
PubChem CID: 76329079
Max Phase: Preclinical
Molecular Formula: C30H34N4O3
Molecular Weight: 498.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1c(C(=O)N[C@H]2CCCC[C@@H]2O)cc(CN2CCC(C#N)(c3ccccn3)CC2)c2ccccc12
Standard InChI: InChI=1S/C30H34N4O3/c1-37-28-23-9-3-2-8-22(23)21(18-24(28)29(36)33-25-10-4-5-11-26(25)35)19-34-16-13-30(20-31,14-17-34)27-12-6-7-15-32-27/h2-3,6-9,12,15,18,25-26,35H,4-5,10-11,13-14,16-17,19H2,1H3,(H,33,36)/t25-,26-/m0/s1
Standard InChI Key: OQRQUUPWUGLIMP-UIOOFZCWSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
15.6449 -2.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6438 -3.4073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3518 -3.8162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3500 -2.1789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0586 -2.5841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0620 -3.4093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7744 -3.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4880 -3.4035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4846 -2.5783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7676 -2.1663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7631 -1.3492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1916 -2.1654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9005 -2.5718 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1890 -1.3482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7766 -4.6339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4936 -5.0238 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0532 -0.9445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8955 -0.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6025 -1.3478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3069 -0.9405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3085 -0.1230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5997 0.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8892 -0.1234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6019 -2.1650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5028 -5.8408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2140 -6.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9163 -5.8176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9029 -4.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1871 -4.5999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3559 -6.5149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7349 -5.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5516 -5.8345 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9696 -7.2444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4093 -7.9408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2338 -7.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6168 -7.1735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1749 -6.4801 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
12 13 2 0
12 14 1 0
9 12 1 0
7 15 1 0
15 16 1 0
11 17 1 0
18 14 1 1
18 19 1 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
19 24 1 6
16 25 1 0
16 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
27 30 1 0
27 31 1 0
31 32 3 0
30 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.63Molecular Weight (Monoisotopic): 498.2631AlogP: 4.33#Rotatable Bonds: 6Polar Surface Area: 98.48Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.57CX LogP: 3.53CX LogD: 3.14Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.52Np Likeness Score: -0.61
References 1. Kuduk SD, Di Marco CN, Saffold JR, Ray WJ, Ma L, Wittmann M, Koeplinger KA, Thompson CD, Hartman GD, Bilodeau MT, Beshore DC.. (2014) Identification of a methoxynaphthalene scaffold as a core replacement in quinolizidinone amide M(1) positive allosteric modulators., 24 (5): [PMID:24485781 ] [10.1016/j.bmcl.2014.01.012 ]