The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,1,1,3,3,3-Hexafluoro-2-(4-((2S)-2-(4-morpholinylmethyl)-4-(2-thiophenylsulfonyl)-1-piperazinyl)phenyl)-2-propanol ID: ALA3127348
PubChem CID: 76311063
Max Phase: Preclinical
Molecular Formula: C22H25F6N3O4S2
Molecular Weight: 573.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(c1cccs1)N1CCN(c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)[C@@H](CN2CCOCC2)C1
Standard InChI: InChI=1S/C22H25F6N3O4S2/c23-21(24,25)20(32,22(26,27)28)16-3-5-17(6-4-16)31-8-7-30(37(33,34)19-2-1-13-36-19)15-18(31)14-29-9-11-35-12-10-29/h1-6,13,18,32H,7-12,14-15H2/t18-/m0/s1
Standard InChI Key: QAIPKSPQMAFRIQ-SFHVURJKSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
2.1621 -2.4595 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.1570 -1.6345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4451 -2.0516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3962 -1.7379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9871 -2.4544 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4030 -3.1620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2237 -3.1605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6328 -2.4440 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2211 -1.7291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4566 -2.4422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8698 -3.1575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6940 -3.1563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1060 -2.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6877 -1.7245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8648 -1.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9310 -2.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3458 -3.1510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3411 -1.7221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7540 -2.4374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1661 -1.7194 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.9263 -1.0089 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.7458 -1.0042 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.9356 -3.8667 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.1708 -3.1484 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.7540 -3.8624 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.7542 -3.1766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9299 -3.2702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7634 -4.0782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4805 -4.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0901 -3.9303 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.6386 -3.8735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2286 -4.5894 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4044 -4.5899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9944 -5.3048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4093 -6.0189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2387 -6.0134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6449 -5.2979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
1 3 2 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 10 1 0
13 16 1 0
16 17 1 0
16 18 1 0
16 19 1 0
18 20 1 0
18 21 1 0
18 22 1 0
17 23 1 0
17 24 1 0
17 25 1 0
5 1 1 0
1 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 26 1 0
7 31 1 1
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 573.58Molecular Weight (Monoisotopic): 573.1191AlogP: 3.27#Rotatable Bonds: 6Polar Surface Area: 73.32Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.52CX Basic pKa: 6.12CX LogP: 3.52CX LogD: 3.42Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.54Np Likeness Score: -1.67
References 1. Ashton KS, Andrews KL, Bryan MC, Chen J, Chen K, Chen M, Chmait S, Croghan M, Cupples R, Fotsch C, Helmering J, Jordan SR, Kurzeja RJ, Michelsen K, Pennington LD, Poon SF, Sivits G, Van G, Vonderfecht SL, Wahl RC, Zhang J, Lloyd DJ, Hale C, St Jean DJ.. (2014) Small molecule disruptors of the glucokinase-glucokinase regulatory protein interaction: 1. Discovery of a novel tool compound for in vivo proof-of-concept., 57 (2): [PMID:24405172 ] [10.1021/jm4016735 ]