(2S)-1,1,1-Trifluoro-2-(4-((2S)-2-(tetrahydro-2H-pyran-4-ylmethyl)-4-(2-thiophenylsulfonyl)-1-piperazinyl)phenyl)-2-propanol

ID: ALA3127351

PubChem CID: 66583091

Max Phase: Preclinical

Molecular Formula: C23H29F3N2O4S2

Molecular Weight: 518.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@](O)(c1ccc(N2CCN(S(=O)(=O)c3cccs3)C[C@@H]2CC2CCOCC2)cc1)C(F)(F)F

Standard InChI:  InChI=1S/C23H29F3N2O4S2/c1-22(29,23(24,25)26)18-4-6-19(7-5-18)28-11-10-27(34(30,31)21-3-2-14-33-21)16-20(28)15-17-8-12-32-13-9-17/h2-7,14,17,20,29H,8-13,15-16H2,1H3/t20-,22-/m0/s1

Standard InChI Key:  XYVKOMVNXJFBFF-UNMCSNQZSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    3.8050   -4.1904    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.7999   -3.3691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0906   -3.7821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0315   -3.4715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6263   -4.1852    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0382   -4.8903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8554   -4.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2647   -4.1750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8527   -3.4627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0848   -4.1732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4941   -4.8817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3146   -4.8805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7268   -4.1715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3084   -3.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4892   -3.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5482   -4.1689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9590   -4.8753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9545   -3.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3676   -4.1685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7758   -3.4531    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.5436   -2.7452    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.3593   -2.7405    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.3967   -4.9048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5761   -4.9975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4113   -5.8021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1257   -6.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7294   -5.6514    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.2705   -5.5951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8601   -6.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0396   -6.3088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6335   -7.0212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0445   -7.7326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8701   -7.7272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2766   -7.0143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  1  3  2  0
  4  5  1  0
  4  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 10  1  0
 13 16  1  0
 16 17  1  0
 16 18  1  6
 16 19  1  0
 18 20  1  0
 18 21  1  0
 18 22  1  0
  5  1  1  0
  1 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 23  1  0
  7 28  1  1
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 29  1  0
M  END

Associated Targets(Human)

GCKR Tchem Glucokinase regulatory protein (190 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Gckr Glucokinase regulatory protein (18 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 518.62Molecular Weight (Monoisotopic): 518.1521AlogP: 4.21#Rotatable Bonds: 6
Polar Surface Area: 70.08Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.86CX Basic pKa: 2.45CX LogP: 4.09CX LogD: 4.09
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.62Np Likeness Score: -1.38

References

1. Ashton KS, Andrews KL, Bryan MC, Chen J, Chen K, Chen M, Chmait S, Croghan M, Cupples R, Fotsch C, Helmering J, Jordan SR, Kurzeja RJ, Michelsen K, Pennington LD, Poon SF, Sivits G, Van G, Vonderfecht SL, Wahl RC, Zhang J, Lloyd DJ, Hale C, St Jean DJ..  (2014)  Small molecule disruptors of the glucokinase-glucokinase regulatory protein interaction: 1. Discovery of a novel tool compound for in vivo proof-of-concept.,  57  (2): [PMID:24405172] [10.1021/jm4016735]

Source