The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1-(7-Methoxyheptaphilline)-N3-(1,2,3,4-tetrahydroacridine-9-yl)propane-1,3-diamine ID: ALA3127383
PubChem CID: 136264303
Max Phase: Preclinical
Molecular Formula: C35H38N4O2
Molecular Weight: 546.72
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)[nH]c1c(CC=C(C)C)c(O)c(/C=N/CCCNc3c4c(nc5ccccc35)CCCC4)cc12
Standard InChI: InChI=1S/C35H38N4O2/c1-22(2)13-15-28-34-29(25-16-14-24(41-3)20-32(25)39-34)19-23(35(28)40)21-36-17-8-18-37-33-26-9-4-6-11-30(26)38-31-12-7-5-10-27(31)33/h4,6,9,11,13-14,16,19-21,39-40H,5,7-8,10,12,15,17-18H2,1-3H3,(H,37,38)/b36-21+
Standard InChI Key: CTJAAWWQYIKUKG-QLQYKETESA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
8.3090 -6.3937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3090 -7.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0234 -7.6313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7379 -7.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7379 -6.3937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0234 -5.9813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5225 -7.4737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0075 -6.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5225 -6.1388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8279 -6.7200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1635 -5.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6786 -5.2989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8581 -5.3851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0234 -8.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3090 -8.8688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3090 -9.6937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5945 -10.1063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0234 -10.1063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5945 -7.6313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5945 -5.9813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5945 -5.1563 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8800 -4.7438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1656 -5.1563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4511 -4.7438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7366 -5.1563 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0221 -4.7438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0221 -3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3077 -3.5062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5932 -3.9188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5932 -4.7438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3077 -5.1563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8787 -5.1563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8787 -5.9813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5932 -6.3937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3077 -5.9813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7366 -3.5062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7366 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0221 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3077 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9840 -5.8801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3195 -5.1264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 9 1 0
3 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
16 18 1 0
2 19 1 0
1 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
30 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 31 1 0
27 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 28 1 0
11 40 1 0
40 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 546.72Molecular Weight (Monoisotopic): 546.2995AlogP: 7.89#Rotatable Bonds: 9Polar Surface Area: 82.53Molecular Species: BASEHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.16CX Basic pKa: 8.98CX LogP: 6.05CX LogD: 5.65Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.10Np Likeness Score: 0.20
References 1. Thiratmatrakul S, Yenjai C, Waiwut P, Vajragupta O, Reubroycharoen P, Tohda M, Boonyarat C.. (2014) Synthesis, biological evaluation and molecular modeling study of novel tacrine-carbazole hybrids as potential multifunctional agents for the treatment of Alzheimer's disease., 75 [PMID:24508831 ] [10.1016/j.ejmech.2014.01.020 ]