The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Sinugyrosanolide A ID: ALA3127575
PubChem CID: 76314712
Max Phase: Preclinical
Molecular Formula: C19H22O5
Molecular Weight: 330.38
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C(C)[C@@H]1CC(=O)C[C@H]2C(=O)[C@@H]3[C@@H]4C(=C[C@@H]12)C(=O)O[C@@H]4C[C@]3(C)O
Standard InChI: InChI=1S/C19H22O5/c1-8(2)10-4-9(20)5-12-11(10)6-13-15-14(24-18(13)22)7-19(3,23)16(15)17(12)21/h6,10-12,14-16,23H,1,4-5,7H2,2-3H3/t10-,11-,12+,14+,15+,16-,19-/m0/s1
Standard InChI Key: YJJAMYDPWUFEHG-LSEBWTMBSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
7.2553 -4.5743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2553 -5.3993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9697 -5.8118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6842 -5.3993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6842 -4.5743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9697 -4.1618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0089 -3.9283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3533 -4.4291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6270 -5.2074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4518 -5.1876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6878 -4.3971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3910 -5.9979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0699 -6.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7255 -5.9659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4847 -4.1836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7341 -5.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0897 -7.2914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2553 -6.2243 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.2553 -3.7493 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2768 -5.1876 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.3987 -4.1618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9697 -6.6368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6842 -7.0493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2553 -7.0493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4385 -3.2240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6137 -3.2240 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5702 -3.3630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9014 -3.6002 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.8020 -5.2074 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 1 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 7 1 0
9 12 1 0
12 13 1 0
13 14 1 0
14 10 1 0
11 15 1 0
14 16 2 0
15 1 1 0
2 16 1 0
13 17 2 0
2 18 1 1
1 19 1 1
10 20 1 1
5 21 2 0
3 22 1 1
22 23 2 0
22 24 1 0
7 25 1 0
7 26 1 6
15 27 2 0
11 28 1 1
9 29 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 330.38Molecular Weight (Monoisotopic): 330.1467AlogP: 1.60#Rotatable Bonds: 1Polar Surface Area: 80.67Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 1.13CX LogD: 1.13Aromatic Rings: ┄Heavy Atoms: 24QED Weighted: 0.58Np Likeness Score: 2.61
References 1. Cheng SY, Shih NL, Chuang CT, Chiou SF, Yang CN, Wang SK, Duh CY.. (2014) Sinugyrosanolide A, an unprecedented C-4 norcembranoid, from the Formosan soft coral Sinularia gyrosa., 24 (6): [PMID:24529868 ] [10.1016/j.bmcl.2014.01.073 ]