The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-bromo-N-(3-((1-phenethyl-1H-pyrazolo[3,4-d]pyrimidin-4-ylamino)methyl)phenyl)benzamide ID: ALA3128229
PubChem CID: 76329234
Max Phase: Preclinical
Molecular Formula: C27H23BrN6O
Molecular Weight: 527.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cccc(CNc2ncnc3c2cnn3CCc2ccccc2)c1)c1ccc(Br)cc1
Standard InChI: InChI=1S/C27H23BrN6O/c28-22-11-9-21(10-12-22)27(35)33-23-8-4-7-20(15-23)16-29-25-24-17-32-34(26(24)31-18-30-25)14-13-19-5-2-1-3-6-19/h1-12,15,17-18H,13-14,16H2,(H,33,35)(H,29,30,31)
Standard InChI Key: KEFIPKHDSKXZAY-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
6.6888 -2.5547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6877 -3.3743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3957 -3.7832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1054 -3.3738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1026 -2.5511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3939 -2.1459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3955 -4.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6877 -5.0088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6875 -5.8260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9789 -6.2301 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9783 -7.0466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6865 -7.4562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3937 -6.2283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3991 -7.0471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1796 -7.2950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6566 -6.6293 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1708 -5.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4373 -8.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2377 -8.2352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4954 -9.0107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9515 -9.6207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2086 -10.3956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0098 -10.5608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5534 -9.9450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2934 -9.1725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8087 -2.1399 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5180 -2.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2241 -2.1345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5210 -3.3630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9318 -2.5438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6375 -2.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6348 -1.3152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9206 -0.9095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2179 -1.3224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3405 -0.9022 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 14 1 0
13 9 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 2 0
17 13 1 0
15 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
5 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
28 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 28 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.43Molecular Weight (Monoisotopic): 526.1117AlogP: 5.70#Rotatable Bonds: 8Polar Surface Area: 84.73Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 3.62CX LogP: 5.53CX LogD: 5.53Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.27Np Likeness Score: -1.76
References 1. Sartini S, Coviello V, Bruno A, La Pietra V, Marinelli L, Simorini F, Taliani S, Salerno S, Marini AM, Fioravanti A, Orlandi P, Antonelli A, Da Settimo F, Novellino E, Bocci G, La Motta C.. (2014) Structure-based optimization of tyrosine kinase inhibitor CLM3. Design, synthesis, functional evaluation, and molecular modeling studies., 57 (4): [PMID:24447248 ] [10.1021/jm401358b ]