The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-bromophenyl)-3-(3-((1-phenethyl-1H-pyrazolo[3,4-d]pyrimidin-4-ylamino)methyl)phenyl)urea ID: ALA3128236
PubChem CID: 76314769
Max Phase: Preclinical
Molecular Formula: C27H24BrN7O
Molecular Weight: 542.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(Br)cc1)Nc1cccc(CNc2ncnc3c2cnn3CCc2ccccc2)c1
Standard InChI: InChI=1S/C27H24BrN7O/c28-21-9-11-22(12-10-21)33-27(36)34-23-8-4-7-20(15-23)16-29-25-24-17-32-35(26(24)31-18-30-25)14-13-19-5-2-1-3-6-19/h1-12,15,17-18H,13-14,16H2,(H,29,30,31)(H2,33,34,36)
Standard InChI Key: ZLIDREACDLOGNW-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
22.3682 -13.2896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3670 -14.1092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0751 -14.5181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7847 -14.1087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7819 -13.2860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0733 -12.8808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0749 -15.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3671 -15.7438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3669 -16.5609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6582 -16.9651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6577 -17.7815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3658 -18.1911 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.0730 -16.9632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0785 -17.7821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8590 -18.0300 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.3360 -17.3642 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8501 -16.7050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1166 -18.8055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9171 -18.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1747 -19.7456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6308 -20.3557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8879 -21.1306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6891 -21.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2327 -20.6800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9728 -19.9075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4881 -12.8748 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1973 -13.2807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9035 -12.8694 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2004 -14.0979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.6127 -13.2754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6127 -14.0914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3211 -14.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0282 -14.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0225 -13.2646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3135 -12.8624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7379 -14.4912 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 14 1 0
13 9 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 2 0
17 13 1 0
15 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
5 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
33 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 542.44Molecular Weight (Monoisotopic): 541.1226AlogP: 6.09#Rotatable Bonds: 8Polar Surface Area: 96.76Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.49CX Basic pKa: 3.62CX LogP: 5.58CX LogD: 5.58Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.22Np Likeness Score: -1.75
References 1. Sartini S, Coviello V, Bruno A, La Pietra V, Marinelli L, Simorini F, Taliani S, Salerno S, Marini AM, Fioravanti A, Orlandi P, Antonelli A, Da Settimo F, Novellino E, Bocci G, La Motta C.. (2014) Structure-based optimization of tyrosine kinase inhibitor CLM3. Design, synthesis, functional evaluation, and molecular modeling studies., 57 (4): [PMID:24447248 ] [10.1021/jm401358b ]