The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-(4-(2-Fluoroethoxy)benzyl)-5-(2-(fluoromethyl)pyrrolidin-1-ylsulfonyl)1H-indole-2,3-dione ID: ALA3133251
PubChem CID: 76336535
Max Phase: Preclinical
Molecular Formula: C22H22F2N2O5S
Molecular Weight: 464.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1C(=O)N(Cc2ccc(OCCF)cc2)c2ccc(S(=O)(=O)N3CCC[C@H]3CF)cc21
Standard InChI: InChI=1S/C22H22F2N2O5S/c23-9-11-31-17-5-3-15(4-6-17)14-25-20-8-7-18(12-19(20)21(27)22(25)28)32(29,30)26-10-1-2-16(26)13-24/h3-8,12,16H,1-2,9-11,13-14H2/t16-/m0/s1
Standard InChI Key: ODDLUJFKRBXEAV-INIZCTEOSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
30.6224 -1.9333 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.0068 -1.2034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1825 -1.2355 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.3524 -2.3177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3832 -3.1446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1134 -3.5295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0478 -1.8778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7784 -2.2590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8106 -3.0848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6060 -3.3094 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0654 -2.6224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5540 -1.9733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8898 -2.5902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.7781 -1.1794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9665 -2.4336 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.1761 -2.1927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7070 -2.8713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2073 -3.5272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9858 -3.2539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8927 -4.0833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6644 -3.7230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4703 -4.7919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6456 -4.7751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2232 -5.4829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6257 -6.2041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4549 -6.2130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8736 -5.5046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5974 -4.5453 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.2042 -6.9132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.3793 -6.9028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9577 -7.6121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1328 -7.6016 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
1 3 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 8 1 0
11 13 2 0
12 14 2 0
4 1 1 0
1 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 15 1 0
10 20 1 0
19 21 1 6
20 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
21 28 1 0
25 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.49Molecular Weight (Monoisotopic): 464.1217AlogP: 2.89#Rotatable Bonds: 8Polar Surface Area: 83.99Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.30CX LogD: 2.30Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.56Np Likeness Score: -1.31
References 1. Krause-Heuer AM, Howell NR, Matesic L, Dhand G, Young EL, Burgess L, Jiang CD, Lengkeek NA, Fookes CJR, Pham TQ, Sobrio F, Greguric I, Fraser BH. (2013) A new class of fluorinated 5-pyrrolidinylsulfonyl isatin caspase inhibitors for PET imaging of apoptosis, 4 (2): [10.1039/C2MD20249B ]