The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-N-[(1S,2S,4S)-4-(1,1'-Biphenyl-4-yloxy)-2-hydroxycyclopentyl]-2,2-diphenylacetamide ID: ALA3134477
PubChem CID: 76336679
Max Phase: Preclinical
Molecular Formula: C31H29NO3
Molecular Weight: 463.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(N[C@H]1C[C@H](Oc2ccc(-c3ccccc3)cc2)C[C@@H]1O)C(c1ccccc1)c1ccccc1
Standard InChI: InChI=1S/C31H29NO3/c33-29-21-27(35-26-18-16-23(17-19-26)22-10-4-1-5-11-22)20-28(29)32-31(34)30(24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-19,27-30,33H,20-21H2,(H,32,34)/t27-,28-,29-/m0/s1
Standard InChI Key: ZGOBTWRMVVFSBP-AWCRTANDSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
12.1764 -6.2531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4227 -5.9176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2626 -7.0736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8438 -5.7682 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3365 -5.0971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0039 -4.6122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9177 -3.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1640 -3.4561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4965 -3.9411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5828 -4.7615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7553 -6.4025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0016 -6.0669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3341 -6.5519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4204 -7.3723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1740 -7.7079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8415 -7.2230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5975 -6.1038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3120 -5.6913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9250 -6.2433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5895 -6.9970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7690 -6.9107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3982 -4.8708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0020 -7.7114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4770 -7.7114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0645 -8.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2395 -8.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8270 -7.7114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2395 -6.9970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0645 -6.9970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3020 -7.7114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7145 -6.9970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5395 -6.9970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9520 -7.7114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5395 -8.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7145 -8.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
5 10 2 0
2 5 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
11 16 2 0
2 11 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
17 21 1 0
18 22 1 1
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
24 29 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
30 35 2 0
24 30 1 0
23 27 1 0
20 23 1 1
17 4 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.58Molecular Weight (Monoisotopic): 463.2147AlogP: 5.57#Rotatable Bonds: 7Polar Surface Area: 58.56Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.99CX Basic pKa: ┄CX LogP: 5.43CX LogD: 5.43Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: 0.11
References 1. Zohrabi-Kalantari V, Wilde F, Grunert R, Bednarski PJ, Link A. (2014) 4-Aminocyclopentane-1,3-diols as platforms for diversity: synthesis of a screening library, 5 (2): [10.1039/C3MD00252G ]