rac-N-[(1S,2S,4S)-4-(1,1'-Biphenyl-4-yloxy)-2-hydroxycyclopentyl]-2,2-diphenylacetamide

ID: ALA3134477

PubChem CID: 76336679

Max Phase: Preclinical

Molecular Formula: C31H29NO3

Molecular Weight: 463.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(N[C@H]1C[C@H](Oc2ccc(-c3ccccc3)cc2)C[C@@H]1O)C(c1ccccc1)c1ccccc1

Standard InChI:  InChI=1S/C31H29NO3/c33-29-21-27(35-26-18-16-23(17-19-26)22-10-4-1-5-11-22)20-28(29)32-31(34)30(24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-19,27-30,33H,20-21H2,(H,32,34)/t27-,28-,29-/m0/s1

Standard InChI Key:  ZGOBTWRMVVFSBP-AWCRTANDSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   12.1764   -6.2531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4227   -5.9176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2626   -7.0736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8438   -5.7682    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3365   -5.0971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0039   -4.6122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9177   -3.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1640   -3.4561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4965   -3.9411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5828   -4.7615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7553   -6.4025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0016   -6.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3341   -6.5519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4204   -7.3723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1740   -7.7079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8415   -7.2230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5975   -6.1038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3120   -5.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9250   -6.2433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5895   -6.9970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7690   -6.9107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3982   -4.8708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0020   -7.7114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4770   -7.7114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0645   -8.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2395   -8.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8270   -7.7114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2395   -6.9970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0645   -6.9970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3020   -7.7114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7145   -6.9970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5395   -6.9970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9520   -7.7114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5395   -8.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7145   -8.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  5 10  2  0
  2  5  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 11 16  2  0
  2 11  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 17 21  1  0
 18 22  1  1
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 24 29  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 30 35  2  0
 24 30  1  0
 23 27  1  0
 20 23  1  1
 17  4  1  6
M  END

Associated Targets(Human)

DAN-G (242 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
5637 (630 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 463.58Molecular Weight (Monoisotopic): 463.2147AlogP: 5.57#Rotatable Bonds: 7
Polar Surface Area: 58.56Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.99CX Basic pKa: CX LogP: 5.43CX LogD: 5.43
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: 0.11

References

1. Zohrabi-Kalantari V, Wilde F, Grunert R, Bednarski PJ, Link A.  (2014)  4-Aminocyclopentane-1,3-diols as platforms for diversity: synthesis of a screening library,  (2): [10.1039/C3MD00252G]

Source