FOSDAGROCORAT

ID: ALA3137316

Cas Number: 1044535-58-1

PubChem CID: 24872952

Product Number: F610382, Order Now?

Max Phase: Phase

Molecular Formula: C29H30F3N2O5P

Molecular Weight: 574.54

Molecule Type: Small molecule

Names and Identifiers

Synonyms: Fosdagrocorat | PF-04171327 | Fosdagrocorat|1044535-58-1|PF-04171327|HPI19004QS|(2R,4aS,10aR)-4a-Benzyl-7-((2-methylpyridin-3-yl)carbamoyl)-2-(trifluoromethyl)-1,2,3,4,4a,9,10,10a-octahydrophenanthren-2-yl dihydrogen phosphate|[(2R,4aS,10aR)-4a-benzyl-7-[(2-methylpyridin-3-yl)carbamoyl]-2-(trifluoromethyl)-1,3,4,9,10,10a-hexahydrophenanthren-2-yl] dihydrogen phosphate|2-Phenanthrenecarboxamide, 4b,5,6,7,8,8a,9,10-octahydro-N-(2-methyl-3-pyridinyl)-4b-(phenylmethyl)-7-(phosphonooxy)-7-(trifluoromShow More⌵

Canonical SMILES:  Cc1ncccc1NC(=O)c1ccc2c(c1)CC[C@@H]1C[C@@](OP(=O)(O)O)(C(F)(F)F)CC[C@@]21Cc1ccccc1

Standard InChI:  InChI=1S/C29H30F3N2O5P/c1-19-25(8-5-15-33-19)34-26(35)22-10-12-24-21(16-22)9-11-23-18-28(29(30,31)32,39-40(36,37)38)14-13-27(23,24)17-20-6-3-2-4-7-20/h2-8,10,12,15-16,23H,9,11,13-14,17-18H2,1H3,(H,34,35)(H2,36,37,38)/t23-,27+,28-/m1/s1

Standard InChI Key:  BVXLAHSJXXSWFF-KEKPKEOLSA-N

Molfile:  

     RDKit          2D

 40 44  0  0  1  0  0  0  0  0999 V2000
    2.8542   -5.8570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8934   -5.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1924   -6.0070    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4915   -5.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4915   -3.7571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1925   -3.0070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375   -0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1962    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1962    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2983    2.2504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2974    3.7512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0006    4.5032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0015    6.0032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3016    6.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5996    5.9995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5975    4.4995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1597    4.4800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8603    5.2309    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8600    6.4309    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8210    4.6310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8210    5.8309    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4600    2.2284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4997    2.8276    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4989    1.6278    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4595    1.0284    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 18 17  1  6
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 14  1  0
 23 18  1  0
 23 24  1  6
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 20 31  1  6
 31 32  1  0
 32 33  2  0
 32 34  1  0
 32 35  1  0
 20 36  1  0
 36 37  1  0
 36 38  1  0
 36 39  1  0
 15 40  2  0
 40 11  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA3137316

   fosdagrocorat

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: Yes

Availability: No

Prodrug: Yes

Calculated Properties

Molecular Weight: 574.54

Molecular Weight (Monoisotopic): 574.1844

AlogP: 6.28

#Rotatable Bonds: 6

Polar Surface Area: 108.75

Molecular Species: ACID

HBA: 4

HBD: 3

#RO5 Violations: 2

HBA (Lipinski): 7

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 0.44

CX Basic pKa: 5.02

CX LogP: 3.07

CX LogD: 1.51

Aromatic Rings: 3

Heavy Atoms: 40

QED Weighted: 0.30

Np Likeness Score: 0.07

References

1. USP Dictionary of USAN and International Names (2010 edition) and USAN registrations 2007-date, 

2. Unpublished dataset, 

3.  (2014)  Tricyclic compounds, compositions, and methods, 

4. Ellen Van Damme.  (2021)  Screening of ~5500 FDA-approved drugs and clinical candidates for anti-SARS-CoV-2 activity,  [10.6019/CHEMBL4651402]

Source

Source(4):

• Clinical Candidates
• USP Dictionary of USAN and International Drug Names
• BindingDB Database
• IMI-CARE SARS-CoV-2 Data