The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N*1*-(5-{3-[4-(3-Amino-propylamino)-butylamino]-propionylamino}-pentyl)-2-[2-(2,4-dihydroxy-phenyl)-acetylamino]-succinamide ID: ALA313747
Cas Number: 112163-33-4
PubChem CID: 119582
Product Number: J302219, Order Now?
Max Phase: Preclinical
Molecular Formula: C27H47N7O6
Molecular Weight: 565.72
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Synonyms: Joro Spider Toxin 3 | Joro spider toxin|Joro toxin|112163-33-4|Joro Spider Toxin 3|JSTX-3|(2S)-N-[5-[3-[4-(3-aminopropylamino)butylamino]propanoylamino]pentyl]-2-[[2-(2,4-dihydroxyphenyl)acetyl]amino]butanediamide|MPT5X293RB|CHEMBL313747|CHEBI:34802|JORO SPIDER TOXIN JSTX-3|Butanediamide, N1-(5-((3-((4-((3-aminopropyl)amino)butyl)amino)-1-oxopropyl)amino)pentyl)-2-(((2,4-dihydroxyphenyl)acetyl)amino)-, (2S)-|AC1L3P2K|Jorotoxin 3|JSTX 3|UNII-MPT5X293RB|GTPL4229|Neurotoxin 3 (Nephila clavata)|DTXS Show More⌵
Canonical SMILES: NCCCNCCCCNCCC(=O)NCCCCCNC(=O)[C@H](CC(N)=O)NC(=O)Cc1ccc(O)cc1O
Standard InChI: InChI=1S/C27H47N7O6/c28-10-6-13-30-11-4-5-12-31-16-9-25(38)32-14-2-1-3-15-33-27(40)22(19-24(29)37)34-26(39)17-20-7-8-21(35)18-23(20)36/h7-8,18,22,30-31,35-36H,1-6,9-17,19,28H2,(H2,29,37)(H,32,38)(H,33,40)(H,34,39)/t22-/m0/s1
Standard InChI Key: SJLRBGDPTALRDM-QFIPXVFZSA-N
Molfile:
RDKit 2D
40 40 0 0 0 0 0 0 0 0999 V2000
-2.9485 -21.3665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9498 -22.1940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2369 -22.6070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5176 -22.1936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5207 -21.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2388 -20.9537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6648 -22.6055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2427 -20.1288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8084 -20.9465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0918 -21.3554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6206 -20.9394 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0878 -22.1804 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3370 -21.3484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0494 -20.9323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7658 -21.3412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0454 -20.1074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4783 -20.9252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1948 -21.3342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9071 -20.9182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6236 -21.3272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3359 -20.9111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0524 -21.3200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7649 -20.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4813 -21.3130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7607 -20.0790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1937 -20.8970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9102 -21.3059 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6226 -20.8898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3391 -21.2988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0514 -20.8828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7679 -21.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4803 -20.8757 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1967 -21.2847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9092 -20.8686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6256 -21.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3380 -20.8616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3411 -22.1734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0576 -22.5822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0616 -23.4072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7700 -22.1662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19 20 1 0
9 10 1 0
20 21 1 0
2 3 1 0
21 22 1 0
10 11 1 0
22 23 1 0
5 6 2 0
23 24 1 0
10 12 2 0
23 25 2 0
6 1 1 0
24 26 1 0
11 13 1 0
26 27 1 0
1 2 2 0
27 28 1 0
13 14 1 0
28 29 1 0
2 7 1 0
29 30 1 0
14 15 1 0
30 31 1 0
3 4 2 0
31 32 1 0
14 16 2 0
32 33 1 0
6 8 1 0
33 34 1 0
15 17 1 0
34 35 1 0
35 36 1 0
17 18 1 0
13 37 1 6
5 9 1 0
37 38 1 0
18 19 1 0
38 39 2 0
4 5 1 0
38 40 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 565.72Molecular Weight (Monoisotopic): 565.3588AlogP: -0.90#Rotatable Bonds: 23Polar Surface Area: 220.93Molecular Species: BASEHBA: 9HBD: 9#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 11#RO5 Violations (Lipinski): 3CX Acidic pKa: 9.09CX Basic pKa: 10.80CX LogP: -3.65CX LogD: -8.01Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.07Np Likeness Score: -0.01
References 1. Yoneda Y, Kawajiri S, Sugimura M, Osanai K, Kito F, Ota E, Mimura T.. (2001) Synthesis of diaminobutane derivatives as potent Ca(2+)-permeable AMPA receptor antagonists., 11 (19): [PMID:11551773 ] [10.1016/s0960-894x(01)00530-3 ] 2. Burns MR, Carlson CL, Vanderwerf SM, Ziemer JR, Weeks RS, Cai F, Webb HK, Graminski GF.. (2001) Amino acid/spermine conjugates: polyamine amides as potent spermidine uptake inhibitors., 44 (22): [PMID:11606128 ] [10.1021/jm0101040 ] 3. Fleming JJ, England PM.. (2010) Developing a complete pharmacology for AMPA receptors: a perspective on subtype-selective ligands., 18 (4): [PMID:20096591 ] [10.1016/j.bmc.2009.12.072 ] 4. Lucas S, Poulsen MH, Nørager NG, Barslund AF, Bach TB, Kristensen AS, Strømgaard K.. (2012) General synthesis of β-alanine-containing spider polyamine toxins and discovery of nephila polyamine toxins 1 and 8 as highly potent inhibitors of ionotropic glutamate receptors., 55 (22): [PMID:23092360 ] [10.1021/jm301255m ] 5. EUbOPEN. (2023) EUbOPEN Chemogenomics Library - IncuCyte, [10.6019/CHEMBL5303304 ]
