(4S,5S,10R,13R,17R)-4-Benzyl-17-((R)-1,5-dimethyl-hexyl)-10,13-dimethyl-hexadecahydro-cyclopenta[a]phenanthren-3-one

ID: ALA3137877

PubChem CID: 10457714

Max Phase: Preclinical

Molecular Formula: C34H52O

Molecular Weight: 476.79

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4[C@H](Cc5ccccc5)C(=O)CC[C@]4(C)[C@H]3CC[C@]12C

Standard InChI:  InChI=1S/C34H52O/c1-23(2)10-9-11-24(3)28-16-17-29-26-14-15-30-27(22-25-12-7-6-8-13-25)32(35)19-21-34(30,5)31(26)18-20-33(28,29)4/h6-8,12-13,23-24,26-31H,9-11,14-22H2,1-5H3/t24-,26+,27+,28-,29+,30+,31+,33-,34+/m1/s1

Standard InChI Key:  LUQXAMMVDIOGHR-AFXVPYTDSA-N

Molfile:  

     RDKit          2D

 40 44  0  0  1  0  0  0  0  0999 V2000
   11.4282   -8.4737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5850   -7.2477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1432   -8.0612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5741   -8.0776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4286   -9.2979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8532   -8.4843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7077   -9.7104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3746   -7.0068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8694   -6.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7068   -8.0620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0035   -9.2987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1427   -7.2371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1328   -9.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3583   -8.3346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8479   -9.3084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8444   -7.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7082  -10.5345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0030   -8.4746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2941   -9.7112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7749   -6.2854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2045   -7.6669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5731   -6.4235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4124  -10.9462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0230   -6.9887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5990   -6.2736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3566   -5.5704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8471   -6.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2653   -7.6919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1275  -10.5337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4071  -11.7703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8537   -8.4019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0894   -7.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1171  -12.1933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8375  -10.9567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8380  -11.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4239  -10.3001    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.2752   -7.5602    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.7170   -8.9925    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.6726   -9.0749    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.3755   -6.9560    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  9  1  0
  1  3  1  0
  6  4  1  0
  1  5  1  0
  3  6  1  0
  5  7  1  0
  2  8  1  0
  9 12  1  0
  1 10  1  0
 11 18  1  0
  3 12  1  0
  5 13  1  0
  4 14  1  0
 15 13  1  0
 16 14  1  0
  7 17  1  6
 18 10  1  0
 19 11  2  0
  8 20  1  1
  1 21  1  1
  2 22  1  1
 23 17  1  0
 24 25  1  0
 20 25  1  0
 20 26  1  6
 27 24  1  0
 28 27  1  0
 29 23  1  0
 30 23  2  0
 31 28  1  0
 32 28  1  0
 33 30  1  0
 34 29  2  0
 35 33  2  0
  5 36  1  6
  7 11  1  0
  6 15  1  0
  4  2  1  0
  8 16  1  0
 34 35  1  0
  3 37  1  6
  6 38  1  1
  4 39  1  6
  8 40  1  6
M  END

Associated Targets(non-human)

Cricetinae gen. sp. (3197 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 476.79Molecular Weight (Monoisotopic): 476.4018AlogP: 9.15#Rotatable Bonds: 7
Polar Surface Area: 17.07Molecular Species: NEUTRALHBA: 1HBD:
#RO5 Violations: 1HBA (Lipinski): 1HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 9.85CX LogD: 9.85
Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: 1.69

References

1. Lin HS, Rampersaud AA, Archer RA, Pawlak JM, Beavers LS, Schmidt RJ, Kauffman RF, Bensch WR, Bumol TF, Apelgren LD..  (1995)  Synthesis and biological evaluation of a new series of sterols as potential hypocholesterolemic agents.,  38  (2): [PMID:7830271] [10.1021/jm00002a010]

Source