The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)4,10,13-Trimethyl-tetradecahydro-cyclopenta[a]phenanthrene-3,6,17-trione 3-[O-(2-amino-ethyl)-oxime] ID: ALA3137924
PubChem CID: 76333105
Max Phase: Preclinical
Molecular Formula: C22H34N2O3
Molecular Weight: 374.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H]1/C(=N/OCCN)CC[C@]2(C)[C@H]3CC[C@]4(C)C(=O)CC[C@H]4[C@@H]3CC(=O)[C@@H]12
Standard InChI: InChI=1S/C22H34N2O3/c1-13-17(24-27-11-10-23)7-9-22(3)16-6-8-21(2)15(4-5-19(21)26)14(16)12-18(25)20(13)22/h13-16,20H,4-12,23H2,1-3H3/b24-17+/t13-,14+,15+,16+,20-,21+,22-/m1/s1
Standard InChI Key: YDWCRPBKXOAXDZ-WBKGZHDISA-N
Molfile:
RDKit 2D
31 34 0 0 1 0 0 0 0 0999 V2000
11.4311 -8.4757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8558 -8.4864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4281 -9.3005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1429 -8.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5872 -7.2524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1409 -9.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5676 -8.0771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8569 -9.3028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7206 -9.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3742 -7.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7183 -8.0643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8743 -6.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1501 -7.2376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0077 -9.3024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3552 -8.3468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2959 -9.7199 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1338 -10.5409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0066 -8.4776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8500 -7.6838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6398 -6.2262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4258 -7.6510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5831 -9.3085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5778 -6.4234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4342 -9.7239 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8671 -9.7220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7217 -10.5386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1542 -9.3105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4209 -10.1253 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.1387 -8.8890 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.8489 -7.6567 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.5715 -8.9056 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4 2 1 0
1 3 1 0
1 4 1 0
5 12 1 0
3 6 1 0
2 7 1 0
2 8 1 0
3 9 1 0
5 10 1 0
1 11 1 0
12 13 1 0
4 13 1 0
14 18 1 0
7 15 1 0
16 14 2 0
17 6 2 0
18 11 1 0
19 15 1 0
20 10 2 0
1 21 1 1
22 16 1 0
5 23 1 1
24 27 1 0
25 22 1 0
9 26 1 6
27 25 1 0
3 28 1 6
9 14 1 0
6 8 1 0
7 5 1 0
19 10 1 0
4 29 1 6
2 30 1 1
7 31 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 374.53Molecular Weight (Monoisotopic): 374.2569AlogP: 3.35#Rotatable Bonds: 3Polar Surface Area: 81.75Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.66CX LogP: 3.18CX LogD: 1.91Aromatic Rings: ┄Heavy Atoms: 27QED Weighted: 0.61Np Likeness Score: 1.81
References 1. De Munari S, Cerri A, Gobbini M, Almirante N, Banfi L, Carzana G, Ferrari P, Marazzi G, Micheletti R, Schiavone A, Sputore S, Torri M, Zappavigna MP, Melloni P.. (2003) Structure-based design and synthesis of novel potent Na+,K+ -ATPase inhibitors derived from a 5alpha,14alpha-androstane scaffold as positive inotropic compounds., 46 (17): [PMID:12904068 ] [10.1021/jm030830y ]