The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E,Z)6,17-Dihydroxy-10,13-dimethyl-hexadecahydro-cyclopenta[a]phenanthren-3-one O-(2-dimethylamino-ethyl)-oxime ID: ALA3137930
PubChem CID: 76325879
Max Phase: Preclinical
Molecular Formula: C23H40N2O3
Molecular Weight: 392.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCO/N=C1\CC[C@@]2(C)[C@H](C1)[C@H](O)C[C@@H]1[C@@H]2CC[C@]2(C)C(O)CC[C@@H]12
Standard InChI: InChI=1S/C23H40N2O3/c1-22-9-7-15(24-28-12-11-25(3)4)13-19(22)20(26)14-16-17-5-6-21(27)23(17,2)10-8-18(16)22/h16-21,26-27H,5-14H2,1-4H3/b24-15+/t16-,17-,18-,19+,20+,21?,22+,23-/m0/s1
Standard InChI Key: AIISYGZXILMWBQ-XMAXWZRWSA-N
Molfile:
RDKit 2D
32 35 0 0 1 0 0 0 0 0999 V2000
11.4236 -8.4703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8487 -8.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1356 -8.0570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5806 -7.2427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5607 -8.0760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4203 -9.2953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8497 -9.3020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1334 -9.7070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8675 -6.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1429 -7.2319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7106 -8.0587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3486 -8.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3678 -7.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7126 -9.7087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9995 -9.2970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2874 -9.7104 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8436 -7.6786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9985 -8.4720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4184 -7.6453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1261 -10.5321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4248 -9.7222 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5744 -9.2987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5712 -6.4176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6336 -6.2246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8582 -9.7121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1451 -9.3088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7118 -9.3105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4341 -10.5471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4130 -10.1204 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.1316 -8.8838 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.8413 -7.6522 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.5635 -8.9004 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
1 3 1 0
4 9 1 0
2 5 1 0
1 6 1 0
8 7 1 0
6 8 1 0
9 10 1 0
3 10 1 0
1 11 1 0
5 12 1 0
4 13 1 0
6 14 1 0
15 18 1 0
16 15 2 0
17 12 1 0
18 11 1 0
1 19 1 1
8 20 1 1
21 26 1 0
22 16 1 0
4 23 1 1
24 13 1 0
25 22 1 0
26 25 1 0
27 21 1 0
28 21 1 0
6 29 1 6
14 15 1 0
2 7 1 0
5 4 1 0
17 13 1 0
3 30 1 6
2 31 1 1
5 32 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 392.58Molecular Weight (Monoisotopic): 392.3039AlogP: 3.30#Rotatable Bonds: 4Polar Surface Area: 65.29Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.82CX LogP: 2.51CX LogD: 1.95Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.57Np Likeness Score: 1.49
References 1. De Munari S, Cerri A, Gobbini M, Almirante N, Banfi L, Carzana G, Ferrari P, Marazzi G, Micheletti R, Schiavone A, Sputore S, Torri M, Zappavigna MP, Melloni P.. (2003) Structure-based design and synthesis of novel potent Na+,K+ -ATPase inhibitors derived from a 5alpha,14alpha-androstane scaffold as positive inotropic compounds., 46 (17): [PMID:12904068 ] [10.1021/jm030830y ]