1-(1-ethynyl)-1-hydroxy-16a,18a-dimethyl-(1R,5aS,16aS,18aS)-1,2,3,3a,3b,4,5,5a,6,13,16,16a,16b,17,18,18a-hexadecahydrocyclopenta[5,6]naphtho[1,2-g]quinazolino[2,3-b]quinazolin-13-one (0.5MH2O)

ID: ALA3138259

PubChem CID: 15118534

Max Phase: Preclinical

Molecular Formula: C30H33N3O2

Molecular Weight: 467.61

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  C#C[C@]1(O)CC[C@H]2[C@@H]3CC[C@H]4Cc5nc6nc7ccccc7c(=O)n6cc5C[C@]4(C)[C@H]3CC[C@@]21C

Standard InChI:  InChI=1S/C30H33N3O2/c1-4-30(35)14-12-23-20-10-9-19-15-25-18(16-28(19,2)22(20)11-13-29(23,30)3)17-33-26(34)21-7-5-6-8-24(21)31-27(33)32-25/h1,5-8,17,19-20,22-23,35H,9-16H2,2-3H3/t19-,20+,22-,23-,28-,29-,30-/m0/s1

Standard InChI Key:  VHQMKHZWPNFWGE-ZTKUAPLSSA-N

Molfile:  

     RDKit          2D

 39 45  0  0  1  0  0  0  0  0999 V2000
    8.5635   -8.4644    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5538   -9.2850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8553   -8.0456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2660   -9.7039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8400   -9.6954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9812   -8.4686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2771   -8.0582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4238   -8.4731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1457   -8.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5774   -7.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9839   -9.3019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1376   -8.0587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5677   -8.0713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8540   -8.4775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7032   -8.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1362   -9.2684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3721   -6.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4142   -9.2939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1623   -6.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8610   -6.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7004   -9.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1432   -7.2255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3564   -8.3336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8525   -9.3067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9565   -6.5822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8567   -7.2248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8492   -7.6760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1305   -9.7127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3735   -6.1780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4293   -7.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4376   -8.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5871   -6.4216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4182   -9.6828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7239   -8.4392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7142   -9.2641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4044  -10.1229    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.1295   -8.8822    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.8392   -7.6509    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.5612   -8.8989    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  2  1  0
  5  2  2  0
  6  7  2  0
  7  1  1  0
  8 15  1  0
  9  3  1  0
 10 20  1  0
 11  6  1  0
  8 12  1  0
 14 13  1  0
 12 14  1  0
 15  6  1  0
 16  9  1  0
 10 17  1  0
  8 18  1  0
 17 19  1  6
 20 22  1  0
 21 11  1  0
 12 22  1  0
 13 23  1  0
 24 28  1  0
 25 19  3  0
 26  3  2  0
 27 23  1  0
 18 28  1  0
 17 29  1  1
  8 30  1  1
 31  9  2  0
 10 32  1  1
 33 16  2  0
 34 31  1  0
 35 34  2  0
 18 36  1  6
 11  4  2  0
 16  5  1  0
 18 21  1  0
 33 35  1  0
 14 24  1  0
 13 10  1  0
 17 27  1  0
 12 37  1  6
 14 38  1  1
 13 39  1  6
M  END

Alternative Forms

1. Parent:

   

   ALA3138259

   (3S,4S,7S,8R,11S,12R,15S)-8-ethynyl-8-hydroxy-3,7-dimethyl-18,20,28-triazaheptacyclo[15.12.0.03,15.04,12.07,11.019,28.021,26]nonacosa-1(29),17,19,21,23,25-hexaen-27-one

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 467.61

Molecular Weight (Monoisotopic): 467.2573

AlogP: 4.56

#Rotatable Bonds: ┄

Polar Surface Area: 67.49

Molecular Species: NEUTRAL

HBA: 5

HBD: 1

#RO5 Violations: ┄

HBA (Lipinski): 5

HBD (Lipinski): 1

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: 1.56

CX LogP: 4.63

CX LogD: 4.63

Aromatic Rings: 3

Heavy Atoms: 35

QED Weighted: 0.39

Np Likeness Score: 0.61

References

1. Venepalli BR, Aimone LD, Appell KC, Bell MR, Dority JA, Goswami R, Hall PL, Kumar V, Lawrence KB, Logan ME..  (1992)  Synthesis and substance P receptor binding activity of androstano[3,2-b]pyrimido[1,2-a]benzimidazoles.,  35  (2): [PMID:1370695] [10.1021/jm00080a025]

Source

Source(1):

• Scientific Literature