ESTRIOL BENZYL ETHER

ID: ALA3138703

Cas Number: 18650-87-8

PubChem CID: 16100983

Product Number: O336496, Order Now?

Max Phase: Preclinical

Molecular Formula: C25H30O3

Molecular Weight: 378.51

Molecule Type: Small molecule

Associated Items:

This product is currently unavailable

Names and Identifiers

Canonical SMILES:  C[C@]12CC[C@@H]3c4ccc(OCc5ccccc5)cc4CC[C@H]3[C@@H]1C[C@@H](O)[C@@H]2O

Standard InChI:  InChI=1S/C25H30O3/c1-25-12-11-20-19-10-8-18(28-15-16-5-3-2-4-6-16)13-17(19)7-9-21(20)22(25)14-23(26)24(25)27/h2-6,8,10,13,20-24,26-27H,7,9,11-12,14-15H2,1H3/t20-,21-,22+,23-,24+,25+/m1/s1

Standard InChI Key:  GDUPBUZZJUIEDX-RIQJQHKOSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    1.6718   -1.1368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3915   -0.3608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5794   -0.2156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0476   -0.8463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7645   -0.7011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4964   -1.1100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0429    0.1455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0448    0.0748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7257   -0.3175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1400   -1.7675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3279   -1.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2991    0.5603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2963   -1.3318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5130    0.7055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8569    0.2200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3888   -0.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2009   -0.2655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0027   -1.7613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1085   -1.1866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0317   -1.8791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5016   -0.0372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7327   -0.8962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5448   -0.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8251    0.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0766   -1.3817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8888   -1.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6372    0.1702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1691   -0.4605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8634    0.5589    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4797    0.4594    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4842   -1.4770    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4 11  1  0
  5  4  1  0
  6  1  1  0
  7  2  1  0
  8  5  1  0
  9  6  1  0
 10  1  1  0
 11 10  1  0
 12  3  1  0
 13  5  2  0
 14 12  1  0
 15  8  2  0
 16 19  2  0
 17 16  1  0
  6 18  1  6
 19 13  1  0
  1 20  1  6
  9 21  1  1
 22 17  1  0
 23 22  1  0
 24 23  2  0
 25 23  1  0
 26 25  2  0
 27 24  1  0
 28 26  1  0
  9  7  1  0
  4  3  1  0
  8 14  1  0
 16 15  1  0
 28 27  2  0
  3 29  1  6
  2 30  1  1
  4 31  1  1
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

SLCO1B1 Tchem Solute carrier organic anion transporter family member 1B1 (2672 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SLCO1B3 Tchem Solute carrier organic anion transporter family member 1B3 (2517 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 378.51Molecular Weight (Monoisotopic): 378.2195AlogP: 4.45#Rotatable Bonds: 3
Polar Surface Area: 49.69Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.62CX Basic pKa: CX LogP: 4.54CX LogD: 4.54
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.83Np Likeness Score: 1.39

References

1. De Bruyn T, van Westen GJ, Ijzerman AP, Stieger B, de Witte P, Augustijns PF, Annaert PP..  (2013)  Structure-based identification of OATP1B1/3 inhibitors.,  83  (6): [PMID:23571415] [10.1124/mol.112.084152]

Source