The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
DIHYDROGEDUNIC ACID, METHYL ESTER ID: ALA3138714
PubChem CID: 40469808
Max Phase: Preclinical
Molecular Formula: C26H36O8
Molecular Weight: 476.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@@H]1OC(=O)[C@H]2O[C@]23[C@@]2(C)[C@H](CC[C@@]13C)[C@@]1(C)CCC(=O)C(C)(C)[C@@H]1C[C@H]2OC(C)=O
Standard InChI: InChI=1S/C26H36O8/c1-13(27)32-17-12-15-22(2,3)16(28)9-10-23(15,4)14-8-11-24(5)18(20(29)31-7)33-21(30)19-26(24,34-19)25(14,17)6/h14-15,17-19H,8-12H2,1-7H3/t14-,15+,17-,18+,19-,23-,24+,25+,26-/m1/s1
Standard InChI Key: CDTMPWYDQKWYFT-KVJCSQEISA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
0.8304 -0.1232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5536 -0.5357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1125 -0.5357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8304 0.7179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8143 -0.8304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3179 -0.5357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5946 -0.1179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2768 -0.1179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3179 -1.3607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5536 1.1357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2768 0.7179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1125 -1.3607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0411 -1.7839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5946 -1.7839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1125 1.1357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5519 1.9394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5946 0.7179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7536 -1.3607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0411 -0.1179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8126 -1.7560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5052 -1.3478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8336 -0.4392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7536 -0.5357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9944 2.2595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3123 -1.6787 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0650 -1.6638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1130 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8314 1.3607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3179 0.1071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2471 2.3433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4781 -2.0944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6060 -2.0908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5002 -0.8120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2458 2.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0545 -0.8082 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.5946 -0.9429 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.2680 -0.9482 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 1 1 0
1 5 1 1
6 7 1 0
7 3 1 0
8 2 1 0
9 14 1 0
10 4 1 0
11 10 1 0
12 3 1 0
13 9 1 0
14 12 1 0
15 4 1 0
10 16 1 6
17 15 1 0
18 13 1 0
19 6 1 0
12 20 1 6
21 20 1 0
22 8 2 0
23 19 1 0
24 16 2 0
25 18 2 0
26 21 2 0
3 27 1 1
4 28 1 6
6 29 1 1
30 16 1 0
31 13 1 0
32 13 1 0
33 21 1 0
34 30 1 0
5 2 1 0
7 17 1 0
11 8 1 0
9 6 1 0
23 18 1 0
9 35 1 6
7 36 1 6
2 37 1 6
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.57Molecular Weight (Monoisotopic): 476.2410AlogP: 2.99#Rotatable Bonds: 2Polar Surface Area: 108.50Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.21CX LogD: 3.21Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.34Np Likeness Score: 2.96
References 1. De Bruyn T, van Westen GJ, Ijzerman AP, Stieger B, de Witte P, Augustijns PF, Annaert PP.. (2013) Structure-based identification of OATP1B1/3 inhibitors., 83 (6): [PMID:23571415 ] [10.1124/mol.112.084152 ]