The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Tfa-VAL-TYR-VAL-OH ID: ALA3138715
Cas Number: 64577-63-5
PubChem CID: 40785040
Max Phase: Preclinical
Molecular Formula: C21H28F3N3O6
Molecular Weight: 475.46
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)C(F)(F)F)C(C)C)C(=O)O
Standard InChI: InChI=1S/C21H28F3N3O6/c1-10(2)15(27-20(33)21(22,23)24)18(30)25-14(9-12-5-7-13(28)8-6-12)17(29)26-16(11(3)4)19(31)32/h5-8,10-11,14-16,28H,9H2,1-4H3,(H,25,30)(H,26,29)(H,27,33)(H,31,32)/t14-,15-,16-/m0/s1
Standard InChI Key: SAVSLMGBKQKUAV-JYJNAYRXSA-N
Molfile:
RDKit 2D
33 33 0 0 0 0 0 0 0 0999 V2000
-1.5908 -3.9223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1927 -2.6639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7889 -4.7232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7981 -3.6935 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5706 -1.9774 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7779 -2.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3908 -1.8630 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6000 -2.8927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1651 -2.5495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1835 -1.6342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9669 -3.3503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7872 -3.2359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1852 -3.3503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5798 -3.0071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3816 -0.8334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5614 -3.9223 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9871 -5.5240 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.9881 -4.9214 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.5898 -4.5250 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.1944 -2.3207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9577 -2.3207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1743 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1743 -3.5791 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7595 -0.1469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7687 -1.1766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3724 0.1963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1651 0.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5614 -0.9478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5522 0.0819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1558 -1.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5522 -2.8927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9871 -2.5495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9963 -1.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 8 1 0
3 1 1 0
4 1 1 0
5 6 1 0
10 6 1 0
7 2 1 0
8 4 1 0
9 5 1 0
10 7 1 1
11 9 1 0
12 2 2 0
13 1 2 0
14 6 2 0
10 15 1 0
16 11 2 0
17 3 1 0
18 3 1 0
19 3 1 0
8 20 1 1
9 21 1 1
22 15 1 0
23 11 1 0
24 27 1 0
25 22 2 0
26 22 1 0
27 26 2 0
28 25 1 0
29 24 1 0
30 21 1 0
31 21 1 0
32 20 1 0
33 20 1 0
28 24 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.46Molecular Weight (Monoisotopic): 475.1930AlogP: 1.35#Rotatable Bonds: 10Polar Surface Area: 144.83Molecular Species: ACIDHBA: 5HBD: 5#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.71CX Basic pKa: ┄CX LogP: 2.43CX LogD: -1.20Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.35Np Likeness Score: 0.00
References 1. De Bruyn T, van Westen GJ, Ijzerman AP, Stieger B, de Witte P, Augustijns PF, Annaert PP.. (2013) Structure-based identification of OATP1B1/3 inhibitors., 83 (6): [PMID:23571415 ] [10.1124/mol.112.084152 ]