The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
TETRAHYDROCORTISONE-21-ACETATE ID: ALA3138721
Cas Number: 17736-20-8
PubChem CID: 223685
Max Phase: Preclinical
Molecular Formula: C23H34O6
Molecular Weight: 406.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C(=O)C[C@@]21C
Standard InChI: InChI=1S/C23H34O6/c1-13(24)29-12-19(27)23(28)9-7-17-16-5-4-14-10-15(25)6-8-21(14,2)20(16)18(26)11-22(17,23)3/h14-17,20,25,28H,4-12H2,1-3H3/t14-,15-,16+,17+,20-,21+,22+,23+/m1/s1
Standard InChI Key: MULICLCRGFYQJF-LLTWYMBTSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
0.0719 -3.3989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0719 -4.2239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7839 -4.6323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7839 -2.9823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4959 -3.3989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4970 -4.2239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2080 -4.6332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9226 -4.2221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2059 -2.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9234 -3.3978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9222 -1.7433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2022 -2.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6397 -2.1579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6366 -2.9873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4245 -3.2467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9147 -2.5774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4296 -1.9046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6420 -4.6375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4885 -2.5739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4927 -5.0448 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.6344 -1.3323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2010 -3.8073 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.6302 -3.8114 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.9177 -2.5698 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4873 -1.7452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4296 -1.0796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2265 -1.6911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8099 -2.2744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4400 -0.8942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6067 -2.0609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1901 -2.6443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9870 -2.4307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9766 -3.4411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11 12 1 0
13 14 1 0
1 2 1 0
1 4 1 0
2 3 1 0
5 9 1 0
6 7 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
7 8 1 0
2 18 1 6
8 10 1 0
5 19 1 1
9 10 1 0
6 20 1 1
3 6 1 0
13 21 1 1
5 4 1 0
5 6 1 0
9 12 1 0
9 22 1 6
10 14 1 0
14 23 1 6
13 11 1 0
10 24 1 1
12 25 2 0
17 26 1 6
17 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 406.52Molecular Weight (Monoisotopic): 406.2355AlogP: 2.43#Rotatable Bonds: 3Polar Surface Area: 100.90Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.60CX Basic pKa: ┄CX LogP: 1.94CX LogD: 1.94Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.70Np Likeness Score: 2.15
References 1. De Bruyn T, van Westen GJ, Ijzerman AP, Stieger B, de Witte P, Augustijns PF, Annaert PP.. (2013) Structure-based identification of OATP1B1/3 inhibitors., 83 (6): [PMID:23571415 ] [10.1124/mol.112.084152 ]