The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ANDROSTERONE SODIUM SULFATE ID: ALA3138725
PubChem CID: 23692708
Max Phase: Preclinical
Molecular Formula: C19H29NaO5S
Molecular Weight: 370.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@]12CC[C@@H](OS(=O)(=O)[O-])C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12.[Na+]
Standard InChI: InChI=1S/C19H30O5S.Na/c1-18-9-7-13(24-25(21,22)23)11-12(18)3-4-14-15-5-6-17(20)19(15,2)10-8-16(14)18;/h12-16H,3-11H2,1-2H3,(H,21,22,23);/q;+1/p-1/t12-,13+,14-,15-,16-,18-,19-;/m0./s1
Standard InChI Key: CZADSKBJSXZLIB-CZVIMANZSA-M
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
6.0203 -2.4829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6661 -3.9787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6661 -4.8037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3781 -5.2121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3781 -3.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0901 -3.9787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0912 -4.8037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8022 -5.2130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5168 -4.8019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8001 -3.5630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5177 -3.9776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5164 -2.3231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7964 -2.7367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2340 -2.7377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2308 -3.5671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0188 -3.8265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5089 -3.1572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9522 -5.2173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0828 -3.1537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5119 -3.1496 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.2244 -4.3912 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.0161 -1.9371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2761 -1.6985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7953 -4.3871 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.0870 -5.6246 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.2378 -4.8048 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.4767 -5.2173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1747 -4.0904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6503 -4.0904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8175 -5.3522 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
4 7 1 0
6 5 1 0
11 20 1 1
6 7 1 0
15 21 1 6
10 13 1 0
11 15 1 0
14 12 1 0
12 13 1 0
14 15 1 0
2 3 1 0
2 5 1 0
3 4 1 0
6 10 1 0
7 8 1 0
15 16 1 0
16 17 1 0
17 1 1 0
1 14 1 0
8 9 1 0
3 18 1 6
9 11 1 0
14 22 1 1
1 23 2 0
10 11 1 0
10 24 1 6
6 19 1 1
7 25 1 6
18 26 1 0
26 27 1 0
26 28 2 0
26 29 2 0
M CHG 2 27 -1 30 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 370.51Molecular Weight (Monoisotopic): 370.1814AlogP: 3.79#Rotatable Bonds: 2Polar Surface Area: 80.67Molecular Species: ACIDHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: -1.33CX Basic pKa: ┄CX LogP: 3.82CX LogD: 1.45Aromatic Rings: ┄Heavy Atoms: 25QED Weighted: 0.75Np Likeness Score: 2.52
References 1. De Bruyn T, van Westen GJ, Ijzerman AP, Stieger B, de Witte P, Augustijns PF, Annaert PP.. (2013) Structure-based identification of OATP1B1/3 inhibitors., 83 (6): [PMID:23571415 ] [10.1124/mol.112.084152 ]