ANDROSTERONE SODIUM SULFATE

ID: ALA3138725

PubChem CID: 23692708

Max Phase: Preclinical

Molecular Formula: C19H29NaO5S

Molecular Weight: 370.51

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@]12CC[C@@H](OS(=O)(=O)[O-])C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12.[Na+]

Standard InChI:  InChI=1S/C19H30O5S.Na/c1-18-9-7-13(24-25(21,22)23)11-12(18)3-4-14-15-5-6-17(20)19(15,2)10-8-16(14)18;/h12-16H,3-11H2,1-2H3,(H,21,22,23);/q;+1/p-1/t12-,13+,14-,15-,16-,18-,19-;/m0./s1

Standard InChI Key:  CZADSKBJSXZLIB-CZVIMANZSA-M

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    6.0203   -2.4829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6661   -3.9787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6661   -4.8037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3781   -5.2121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3781   -3.5621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0901   -3.9787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0912   -4.8037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8022   -5.2130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5168   -4.8019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8001   -3.5630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5177   -3.9776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5164   -2.3231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7964   -2.7367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2340   -2.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2308   -3.5671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0188   -3.8265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5089   -3.1572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9522   -5.2173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0828   -3.1537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5119   -3.1496    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2244   -4.3912    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0161   -1.9371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2761   -1.6985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7953   -4.3871    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0870   -5.6246    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2378   -4.8048    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4767   -5.2173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1747   -4.0904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6503   -4.0904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8175   -5.3522    0.0000 Na  0  0  0  0  0 15  0  0  0  0  0  0
  4  7  1  0
  6  5  1  0
 11 20  1  1
  6  7  1  0
 15 21  1  6
 10 13  1  0
 11 15  1  0
 14 12  1  0
 12 13  1  0
 14 15  1  0
  2  3  1  0
  2  5  1  0
  3  4  1  0
  6 10  1  0
  7  8  1  0
 15 16  1  0
 16 17  1  0
 17  1  1  0
  1 14  1  0
  8  9  1  0
  3 18  1  6
  9 11  1  0
 14 22  1  1
  1 23  2  0
 10 11  1  0
 10 24  1  6
  6 19  1  1
  7 25  1  6
 18 26  1  0
 26 27  1  0
 26 28  2  0
 26 29  2  0
M  CHG  2  27  -1  30   1
M  END

Associated Targets(Human)

SLCO1B3 Tchem Solute carrier organic anion transporter family member 1B3 (2517 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SLCO1B1 Tchem Solute carrier organic anion transporter family member 1B1 (2672 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 370.51Molecular Weight (Monoisotopic): 370.1814AlogP: 3.79#Rotatable Bonds: 2
Polar Surface Area: 80.67Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: -1.33CX Basic pKa: CX LogP: 3.82CX LogD: 1.45
Aromatic Rings: Heavy Atoms: 25QED Weighted: 0.75Np Likeness Score: 2.52

References

1. De Bruyn T, van Westen GJ, Ijzerman AP, Stieger B, de Witte P, Augustijns PF, Annaert PP..  (2013)  Structure-based identification of OATP1B1/3 inhibitors.,  83  (6): [PMID:23571415] [10.1124/mol.112.084152]

Source