The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SMILAGENIN ACETATE ID: ALA3138727
Cas Number: 4947-75-5
PubChem CID: 225766
Max Phase: Preclinical
Molecular Formula: C29H46O4
Molecular Weight: 458.68
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)O[C@H]1CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]4[C@H](C[C@@H]32)O[C@]2(CC[C@@H](C)CO2)[C@H]4C)C1
Standard InChI: InChI=1S/C29H46O4/c1-17-8-13-29(31-16-17)18(2)26-25(33-29)15-24-22-7-6-20-14-21(32-19(3)30)9-11-27(20,4)23(22)10-12-28(24,26)5/h17-18,20-26H,6-16H2,1-5H3/t17-,18+,20-,21+,22-,23+,24+,25+,26+,27+,28+,29-/m1/s1
Standard InChI Key: LVRAKYNQYKVPIK-BSPYNPCNSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
0.3843 0.6150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4708 1.2299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3843 -0.1867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7681 -0.6040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1640 0.8785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4379 0.4722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6582 0.2196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0542 -0.1867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3294 -0.6040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1640 -0.4503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6582 1.5594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7681 -1.4386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3294 1.0432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0542 0.6150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4708 -0.1867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3294 -1.4386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8987 -2.6829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4708 -1.8449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0542 -1.8449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9061 -1.8579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1956 -1.4386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4668 -3.0183 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4549 1.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1956 -0.6040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7658 0.0557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4766 2.1936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3243 -3.0075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7662 -1.9884 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.0542 -1.0117 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.3294 0.2210 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3843 -1.0117 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.0707 -0.4948 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.9505 0.0816 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.8998 2.0550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1853 2.4675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4708 2.0549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1853 0.8175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8998 1.2300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6143 2.4675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 11 1 0
3 1 1 0
4 8 1 0
5 1 1 0
6 7 1 0
7 5 1 0
8 14 1 0
9 3 1 0
10 3 1 0
11 5 1 0
12 4 1 0
13 1 1 0
14 13 1 0
15 4 1 0
16 9 1 0
17 20 1 0
12 18 1 0
19 16 1 0
21 20 1 1
21 24 1 0
22 17 2 0
1 23 1 1
24 15 1 0
4 25 1 1
11 26 1 6
27 17 1 0
7 10 1 0
9 8 1 0
2 6 1 0
12 19 1 0
18 21 1 0
12 28 1 1
8 29 1 6
9 30 1 1
3 31 1 6
7 32 1 6
5 33 1 6
2 36 1 6
2 37 1 0
34 35 1 0
35 36 1 0
37 38 1 0
38 34 1 0
34 39 1 6
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.68Molecular Weight (Monoisotopic): 458.3396AlogP: 6.36#Rotatable Bonds: 1Polar Surface Area: 44.76Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.77CX LogD: 5.77Aromatic Rings: ┄Heavy Atoms: 33QED Weighted: 0.43Np Likeness Score: 2.89
References 1. De Bruyn T, van Westen GJ, Ijzerman AP, Stieger B, de Witte P, Augustijns PF, Annaert PP.. (2013) Structure-based identification of OATP1B1/3 inhibitors., 83 (6): [PMID:23571415 ] [10.1124/mol.112.084152 ]