The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
CHOLESTERYL ACETATE ID: ALA3138728
Cas Number: 604-35-3
PubChem CID: 2723897
Product Number: C100098, Order Now?
Max Phase: Preclinical
Molecular Formula: C29H48O2
Molecular Weight: 428.70
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1
Standard InChI: InChI=1S/C29H48O2/c1-19(2)8-7-9-20(3)25-12-13-26-24-11-10-22-18-23(31-21(4)30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10,19-20,23-27H,7-9,11-18H2,1-6H3/t20-,23+,24+,25-,26+,27+,28+,29-/m1/s1
Standard InChI Key: XUGISPSHIFXEHZ-VEVYEIKRSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
1.1696 1.0234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9607 -0.2193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9607 -1.0443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1696 0.1984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2506 0.1880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4595 -0.2089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8901 1.4515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2402 -1.4620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4595 1.4411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4699 -1.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2610 1.0234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6106 0.1880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6917 0.1775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6106 1.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6812 -1.4724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1380 -2.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1361 -1.4831 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3913 -1.0547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7332 -2.6842 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8852 2.3104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3913 -0.2297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1680 1.7100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9687 0.4673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1343 3.5947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5440 -2.6863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1392 2.7360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4779 2.6569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3884 4.0203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3835 4.8791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2129 5.2193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9763 5.2256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4595 0.6161 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.3791 -0.5996 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.2506 -0.6370 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6037 1.8654 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 2 1 0
4 1 1 0
5 11 1 0
6 4 1 0
7 1 1 0
8 10 1 0
9 1 1 0
10 6 1 0
11 9 1 0
12 4 1 0
13 2 1 0
14 7 1 0
15 3 1 0
16 17 1 0
18 17 1 1
18 21 1 0
19 16 2 0
7 20 1 0
21 13 1 0
1 22 1 1
2 23 1 1
24 26 1 0
25 16 1 0
26 20 1 0
20 27 1 1
28 24 1 0
29 28 1 0
30 29 1 0
31 29 1 0
12 14 1 0
6 5 1 0
3 8 2 0
15 18 1 0
6 32 1 1
4 33 1 6
5 34 1 6
7 35 1 6
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.70Molecular Weight (Monoisotopic): 428.3654AlogP: 7.96#Rotatable Bonds: 6Polar Surface Area: 26.30Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.55CX LogD: 7.55Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.32Np Likeness Score: 2.35
References 1. De Bruyn T, van Westen GJ, Ijzerman AP, Stieger B, de Witte P, Augustijns PF, Annaert PP.. (2013) Structure-based identification of OATP1B1/3 inhibitors., 83 (6): [PMID:23571415 ] [10.1124/mol.112.084152 ]