The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-Cyano-phenyl)-3-{4-[2-(2,3-dioxo-5-trifluoromethoxy-2,3-dihydro-indol-1-yl)-acetyl]-piperazine-1-carbonyl}-urea ID: ALA313967
PubChem CID: 44462125
Max Phase: Preclinical
Molecular Formula: C24H19F3N6O6
Molecular Weight: 544.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1cccc(NC(=O)NC(=O)N2CCN(C(=O)CN3C(=O)C(=O)c4cc(OC(F)(F)F)ccc43)CC2)c1
Standard InChI: InChI=1S/C24H19F3N6O6/c25-24(26,27)39-16-4-5-18-17(11-16)20(35)21(36)33(18)13-19(34)31-6-8-32(9-7-31)23(38)30-22(37)29-15-3-1-2-14(10-15)12-28/h1-5,10-11H,6-9,13H2,(H2,29,30,37,38)
Standard InChI Key: JAZJLNXAVOCTBQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
4.8000 -7.3750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2917 -8.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0167 -8.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8042 -8.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0167 -7.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4292 -3.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1417 -2.7417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0042 -6.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1417 -1.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8000 -6.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4292 -3.9792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0125 -5.5667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1500 -8.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9917 1.3708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3000 -7.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3000 -8.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8542 -1.5125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2792 0.9583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1167 -8.0375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0667 -9.4917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7167 -2.7417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8667 -8.8792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0125 -4.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6375 -4.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8042 -5.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4250 -4.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4292 -1.5125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3875 -6.9417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5875 -8.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8542 -0.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4917 -8.0875 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.0125 -7.6042 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.3417 -8.7750 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.5875 -7.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5667 0.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5625 -0.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1417 0.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1417 -0.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8500 0.9583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 5 1 0
4 2 1 0
5 1 1 0
6 11 1 0
7 6 1 0
8 1 1 0
9 7 1 0
10 8 1 0
11 24 1 0
12 10 1 0
13 22 1 0
14 18 3 0
15 5 2 0
16 3 2 0
17 9 1 0
18 35 1 0
19 2 2 0
20 4 2 0
21 6 2 0
22 29 1 0
23 25 1 0
24 26 1 0
25 12 1 0
26 12 1 0
27 9 2 0
28 10 2 0
29 34 2 0
30 17 1 0
31 13 1 0
32 13 1 0
33 13 1 0
34 15 1 0
35 36 2 0
36 30 1 0
37 38 1 0
38 30 2 0
39 37 2 0
3 4 1 0
16 29 1 0
11 23 1 0
39 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 544.45Molecular Weight (Monoisotopic): 544.1318AlogP: 2.07#Rotatable Bonds: 4Polar Surface Area: 152.15Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.10CX Basic pKa: ┄CX LogP: 1.86CX LogD: 1.86Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.56Np Likeness Score: -1.72
References 1. Shuttleworth SJ, Nasturica D, Gervais C, Siddiqui MA, Rando RF, Lee N.. (2000) Parallel synthesis of isatin-based serine protease inhibitors., 10 (22): [PMID:11086715 ] [10.1016/s0960-894x(00)00523-0 ]