Azimilide- dihydrochloride

ID: ALA3140370

Cas Number: 149888-94-8

PubChem CID: 9571003

Product Number: A669786, Order Now?

Max Phase: Phase

Molecular Formula: C23H30Cl3N5O3

Molecular Weight: 457.96

Molecule Type: Small molecule

In stock!

Associated Items:

Names and Identifiers

Synonyms: Azimilide dihydrochloride | Azimilide hydrochloride | NE-10064 | AZIMILIDE DIHYDROCHLORIDE|Azimilide hydrochloride|149888-94-8|Azimilide dihydrochloride [USAN]|Azimilide (Dihydrochloride)|NE-10064|Azimilide 2HCl|Azimilide dihydrochloride (USAN)|(E)-1-(((5-(4-Chlorophenyl)furan-2-yl)methylene)amino)-3-(4-(4-methylpiperazin-1-yl)butyl)imidazolidine-2,4-dione dihydrochloride|1384448-07-0|6E6VJP68KR|NE-10064 Dihydrochloride|1-((5-(p-Chlorophenyl)furfurylidene)amino)-3-(4-(4-methyl-1-piperazinyl)butyShow More

Canonical SMILES:  CN1CCN(CCCCN2C(=O)CN(/N=C/c3ccc(-c4ccc(Cl)cc4)o3)C2=O)CC1.Cl.Cl

Standard InChI:  InChI=1S/C23H28ClN5O3.2ClH/c1-26-12-14-27(15-13-26)10-2-3-11-28-22(30)17-29(23(28)31)25-16-20-8-9-21(32-20)18-4-6-19(24)7-5-18;;/h4-9,16H,2-3,10-15,17H2,1H3;2*1H/b25-16+;;

Standard InChI Key:  HHPSICLSNHCSNZ-BYEGLACWSA-N

Molfile:  

     RDKit          2D

 34 35  0  0  0  0  0  0  0  0999 V2000
   13.5464   -2.9028    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.1418   -1.8826    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3876   -2.2169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8485   -1.6017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0569   -1.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2502   -0.8891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4293   -0.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0272   -1.6849    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1731   -0.4848    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5039   -1.6398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7242   -1.0988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5441   -1.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1434   -3.1211    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7157   -2.2938    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3106   -1.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2455   -2.8614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5481   -0.6211    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8557   -2.2942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1447   -2.2961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4283   -3.5325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4308   -1.8825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7144   -3.1188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2861    0.7425    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.0006   -1.8814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7144   -3.4520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5706   -1.8816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2856   -2.2940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2326   -1.3548    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  2  5  1  0
  4  6  1  0
  5  6  1  0
  4  8  1  0
  7  9  1  0
  7 10  2  0
  9 11  1  0
  8 12  2  0
 11 12  1  0
 10 15  1  0
 11 15  2  0
  3 16  2  0
  7 17  1  0
  5 18  2  0
  2 19  1  0
 17 20  2  0
 17 21  1  0
 13 22  1  0
 13 23  1  0
 14 24  1  0
 22 24  1  0
 14 25  1  0
 23 25  1  0
 21 27  2  0
 26 27  1  0
 20 28  1  0
 26 28  2  0
 26 29  1  0
 14 30  1  0
 13 31  1  0
 19 32  1  0
 30 33  1  0
 32 33  1  0
M  END

Associated Targets(non-human)

SARS-CoV-2 (38078 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
rep Replicase polyprotein 1ab (11336 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: YesAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 457.96Molecular Weight (Monoisotopic): 457.1881AlogP: 3.23#Rotatable Bonds: 8
Polar Surface Area: 72.60Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: 11.95CX Basic pKa: 8.30CX LogP: 2.59CX LogD: 1.64
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.35Np Likeness Score: -1.38

References

1. Lowe R, Glen RC, Mitchell JB..  (2010)  Predicting phospholipidosis using machine learning.,  (5): [PMID:20799726] [10.1021/mp100103e]
2. Kruhlak NL, Choi SS, Contrera JF, Weaver JL, Willard JM, Hastings KL, Sancilio LF..  (2008)  Development of a phospholipidosis database and predictive quantitative structure-activity relationship (QSAR) models.,  18  (2): [PMID:20020916] [10.1080/15376510701857262]
3. USP Dictionary of USAN and International Names (2010 edition) and USAN registrations 2007-date, 
4. Unpublished dataset, 
5. Bernhard Ellinger, Denisa Bojkova, Andrea Zaliani, Jindrich Cinatl, Carsten Claussen, Sandra Westhaus, Jeanette Reinshagen, Maria Kuzikov, Markus Wolf, Gerd Geisslinger, Philip Gribbon, Sandra Ciesek.  (2020)  Identification of inhibitors of SARS-CoV-2 in-vitro cellular toxicity in human (Caco-2) cells using a large scale drug repurposing collection,  [10.21203/rs.3.rs-23951/v1]
6. Maria Kuzikov, Elisa Costanzi, Jeanette Reinshagen, Francesca Esposito, Laura Vangeel, Markus Wolf, Bernhard Ellinger, Carsten Claussen, Gerd Geisslinger, Angela Corona, Daniela Iaconis, Carmine Talarico, Candida Manelfi, Rolando Cannalire, Giulia Rossetti, Jonas Gossen, Simone Albani, Francesco Musiani, Katja Herzog, Yang Ye, Barbara Giabbai, Nicola Demitri, Dirk Jochmans, Steven De Jonghe, Jasper Rymenants, Vincenzo Summa, Enzo Tramontano, Andrea R. Beccari, Pieter Leyssen, Paola Storici, Johan Neyts, Philip Gribbon, and Andrea Zaliani.  (2020)  Identification of inhibitors of SARS-Cov2 M-Pro enzymatic activity using a small molecule repurposing screen,  [10.6019/CHEMBL4495564]
7. Andrea Zaliani, Laura Vangeel, Jeanette Reinshagen, Daniela Iaconis, Maria Kuzikov, Oliver Keminer, Markus Wolf, Bernhard Ellinger, Francesca Esposito, Angela Corona, Enzo Tramontano, Candida Manelfi, Katja Herzog, Dirk Jochmans, Steven De Jonghe, Winston Chiu, Thibault Francken, Joost Schepers, Caroline Collard, Kayvan Abbasi, Carsten Claussen , Vincenzo Summa, Andrea R. Beccari, Johan Neyts, Philip Gribbon and Pieter Leyssen.  (2020)  Cytopathic SARS-Cov2 screening on VERO-E6 cells in a large repurposing effort,  [10.6019/CHEMBL4495565]