The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
{1-[1-(1-Cyclohexylmethyl-2-hydroxy-6-methyl-4-methylcarbamoyl-heptylcarbamoyl)-2-(3H-imidazol-4-yl)-ethylcarbamoyl]-2-phenyl-ethyl}-carbamic acid tert-butyl ester ID: ALA3142429
PubChem CID: 6323453
Max Phase: Preclinical
Molecular Formula: C37H58N6O6
Molecular Weight: 682.91
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)[C@H](CC(C)C)C[C@H](O)[C@H](CC1CCCCC1)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C
Standard InChI: InChI=1S/C37H58N6O6/c1-24(2)17-27(33(45)38-6)20-32(44)29(18-25-13-9-7-10-14-25)41-35(47)31(21-28-22-39-23-40-28)42-34(46)30(19-26-15-11-8-12-16-26)43-36(48)49-37(3,4)5/h8,11-12,15-16,22-25,27,29-32,44H,7,9-10,13-14,17-21H2,1-6H3,(H,38,45)(H,39,40)(H,41,47)(H,42,46)(H,43,48)/t27-,29+,30+,31+,32+/m1/s1
Standard InChI Key: REDPJRNIRCVACW-UGMRNKNYSA-N
Molfile:
RDKit 2D
49 51 0 0 1 0 0 0 0 0999 V2000
5.9647 -5.6612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8550 -4.5698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9352 -3.3226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3149 -5.1935 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1546 -5.5053 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5048 -5.0376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2052 -4.1021 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2559 -3.4571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6651 -4.7257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9140 -7.0644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6145 -6.1289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4541 -6.4408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4246 -4.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2347 -4.2580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8223 -4.6659 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1000 -4.2672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2642 -6.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8043 -5.9730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1251 -3.1666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0746 -3.3550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4753 -2.6989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2347 -6.4408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5850 -3.7903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9352 -5.5053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8845 -6.9085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1841 -7.8440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1841 -5.6612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8550 -2.3871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1039 -6.9085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7453 -5.6612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5343 -5.1935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3444 -7.5321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3739 -5.5053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5850 -1.6075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0755 -2.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6346 -2.1170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5638 -7.5321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0154 -6.4408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2854 -5.0376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5343 -7.3762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6145 -8.3117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8338 -6.1289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1039 -4.7257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0955 -5.1935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8255 -6.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0744 -8.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9942 -7.9999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3656 -5.9730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2642 -8.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 4 1 0
3 7 1 0
4 6 1 0
5 1 1 0
6 1 1 0
7 9 1 0
8 20 1 0
9 2 1 0
10 12 1 0
11 5 1 0
12 17 1 0
13 14 1 0
6 14 1 6
15 13 1 0
16 15 2 0
17 18 1 0
18 11 1 0
19 3 1 0
20 13 2 0
21 3 2 0
22 1 2 0
23 2 2 0
9 24 1 1
11 25 1 1
26 10 2 0
12 27 1 6
28 19 1 0
29 10 1 0
30 24 1 0
18 31 1 6
32 25 1 0
33 27 1 0
34 28 1 0
35 28 1 0
36 28 1 0
37 29 1 0
38 30 1 0
39 30 2 0
40 32 1 0
41 32 1 0
42 33 1 0
43 33 1 0
44 39 1 0
45 38 2 0
46 41 1 0
47 40 1 0
48 44 2 0
49 46 1 0
16 8 1 0
49 47 1 0
48 45 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 682.91Molecular Weight (Monoisotopic): 682.4418AlogP: 4.19#Rotatable Bonds: 17Polar Surface Area: 174.54Molecular Species: NEUTRALHBA: 7HBD: 6#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.23CX Basic pKa: 6.53CX LogP: 4.07CX LogD: 4.02Aromatic Rings: 2Heavy Atoms: 49QED Weighted: 0.15Np Likeness Score: 0.08
References 1. Cozzini P, Fornabaio M, Marabotti A, Abraham DJ, Kellogg GE, Mozzarelli A.. (2002) Simple, intuitive calculations of free energy of binding for protein-ligand complexes. 1. Models without explicit constrained water., 45 (12): [PMID:12036355 ] [10.1021/jm0200299 ]