2-Amino-8-benzyloxy-9-(4-hydroxy-5-hydroxymethyl-tetrahydro-furan-2-yl)-1,9-dihydro-purin-6-one

ID: ALA3143094

Cas Number: 96964-90-8

PubChem CID: 135476520

Product Number: B336591, Order Now?

Max Phase: Preclinical

Molecular Formula: C17H19N5O5

Molecular Weight: 373.37

Molecule Type: Small molecule

In stock!

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1nc(O)c2nc(OCc3ccccc3)n([C@H]3C[C@H](O)[C@@H](CO)O3)c2n1

Standard InChI:  InChI=1S/C17H19N5O5/c18-16-20-14-13(15(25)21-16)19-17(26-8-9-4-2-1-3-5-9)22(14)12-6-10(24)11(7-23)27-12/h1-5,10-12,23-24H,6-8H2,(H3,18,20,21,25)/t10-,11+,12+/m0/s1

Standard InChI Key:  AMEUNRVTNJBDJN-QJPTWQEYSA-N

Molfile:  

     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
    2.9591   -0.4033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1745   -0.1484    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9591   -1.2283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6896   -0.8158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1745   -1.4832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6736    0.0092    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9196    0.6363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6736   -1.6408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3881   -1.2283    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3881   -0.4033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4045    1.3037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1350    0.8912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9196    1.9711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8646   -0.8158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1350    1.7162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6736   -2.4658    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1026    0.0092    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4521   -1.5303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4675    2.2011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1745    2.7558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3729   -1.5303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6225    3.3689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7854   -0.8158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7854   -2.2447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6104   -2.2447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6104   -0.8158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0229   -1.5303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  2  1  0
  5  3  1  0
  6  1  2  0
  7  2  1  1
  8  3  2  0
  9 10  2  0
 10  6  1  0
 11  7  1  0
 12  7  1  0
 13 11  1  0
 14  4  1  0
 15 12  1  0
 16  8  1  0
 17 10  1  0
 18 14  1  0
 15 19  1  6
 13 20  1  1
 21 18  1  0
 22 20  1  0
 23 21  2  0
 24 21  1  0
 25 24  2  0
 26 23  1  0
 27 25  1  0
  5  4  2  0
  9  8  1  0
 15 13  1  0
 27 26  2  0
M  END

Alternative Forms

Associated Targets(Human)

HL-60 (67320 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 373.37Molecular Weight (Monoisotopic): 373.1386AlogP: 0.33#Rotatable Bonds: 5
Polar Surface Area: 148.77Molecular Species: NEUTRALHBA: 10HBD: 4
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 11.37CX Basic pKa: CX LogP: 1.44CX LogD: 1.44
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.50Np Likeness Score: 0.35

References

1. Lin TS, Cheng JC, Ishiguro K, Sartorelli AC..  (1985)  8-Substituted guanosine and 2'-deoxyguanosine derivatives as potential inducers of the differentiation of Friend erythroleukemia cells.,  28  (9): [PMID:3861870] [10.1021/jm00147a012]

Source