The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1-{1-[3-(2-Bromo-ethoxy)-4-chloro-1-oxo-1H-isochromen-7-ylcarbamoyl]-ethylcarbamoyl}-ethyl)-carbamic acid tert-butyl ester ID: ALA3143434
PubChem CID: 10325495
Max Phase: Preclinical
Molecular Formula: C22H27BrClN3O7
Molecular Weight: 560.83
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@@H](C)C(=O)Nc1ccc2c(Cl)c(OCCBr)oc(=O)c2c1
Standard InChI: InChI=1S/C22H27BrClN3O7/c1-11(25-17(28)12(2)26-21(31)34-22(3,4)5)18(29)27-13-6-7-14-15(10-13)19(30)33-20(16(14)24)32-9-8-23/h6-7,10-12H,8-9H2,1-5H3,(H,25,28)(H,26,31)(H,27,29)/t11-,12-/m0/s1
Standard InChI Key: FJSNZYZEOSCEOL-RYUDHWBXSA-N
Molfile:
RDKit 2D
34 35 0 0 0 0 0 0 0 0999 V2000
-3.2711 -3.6483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2711 -4.4733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5566 -4.8858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5566 -3.2358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8421 -3.6483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8421 -4.4733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3026 -4.4733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1591 -4.8858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0157 -4.4733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4447 -4.4733 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5881 -4.8858 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3013 -4.8858 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1277 -3.2358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7302 -4.8858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8736 -4.4733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1277 -4.8858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0170 -4.8858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5566 -5.7108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4132 -4.4733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3026 -3.6483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1591 -5.7108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0157 -3.6483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5566 -2.4108 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.7315 -4.4733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9856 -3.2358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4132 -3.6483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7000 -1.1733 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1.7302 -5.7108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8736 -3.6483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4460 -4.0608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1440 -5.1878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3190 -3.7588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7000 -1.9983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9856 -2.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 1 2 0
5 4 1 0
6 5 2 0
7 11 1 0
8 10 1 0
9 12 1 0
10 14 1 0
11 15 1 0
12 19 1 0
13 5 1 0
14 9 1 0
15 8 1 0
16 6 1 0
17 7 1 0
18 3 2 0
19 26 1 0
20 7 2 0
21 8 2 0
22 9 2 0
23 4 1 0
24 17 1 0
25 1 1 0
26 13 2 0
27 33 1 0
14 28 1 1
15 29 1 6
30 24 1 0
31 24 1 0
32 24 1 0
33 34 1 0
34 25 1 0
3 6 1 0
19 16 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 560.83Molecular Weight (Monoisotopic): 559.0721AlogP: 3.58#Rotatable Bonds: 8Polar Surface Area: 135.97Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.76CX Basic pKa: ┄CX LogP: 3.14CX LogD: 3.14Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -0.73
References 1. Kerrigan JE, Oleksyszyn J, Kam CM, Selzler J, Powers JC.. (1995) Mechanism-based isocoumarin inhibitors for human leukocyte elastase. Effect of the 7-amino substituent and 3-alkoxy group in 3-alkoxy-7-amino-4-chloroisocoumarins on inhibitory potency., 38 (3): [PMID:7853347 ] [10.1021/jm00003a017 ]