The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-N-[2-(3,5-di-tert-butyl-4-hydroxy-benzyl)-3,7,14-trioxo-1,4,8triaza-cyclotetradec-13-yl]-3-phenyl-propionamide ID: ALA3143523
PubChem CID: 11135894
Max Phase: Preclinical
Molecular Formula: C35H51N5O5
Molecular Weight: 621.82
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)c1cc(C[C@@H]2NC(=O)[C@@H](NC(=O)[C@@H](N)Cc3ccccc3)CCCCNC(=O)CCNC2=O)cc(C(C)(C)C)c1O
Standard InChI: InChI=1S/C35H51N5O5/c1-34(2,3)24-18-23(19-25(30(24)42)35(4,5)6)21-28-32(44)38-17-15-29(41)37-16-11-10-14-27(33(45)40-28)39-31(43)26(36)20-22-12-8-7-9-13-22/h7-9,12-13,18-19,26-28,42H,10-11,14-17,20-21,36H2,1-6H3,(H,37,41)(H,38,44)(H,39,43)(H,40,45)/t26-,27-,28-/m0/s1
Standard InChI Key: VMJSQTCIMVQDGV-KCHLEUMXSA-N
Molfile:
RDKit 2D
45 47 0 0 0 0 0 0 0 0999 V2000
4.8274 -1.6810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8274 -0.8560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9695 -4.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6840 -4.5685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9695 -3.3310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9708 -0.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1129 -2.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3984 -1.6810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2563 -0.8560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3984 0.7940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5418 -0.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3984 -3.3310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3984 -0.8560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6840 -5.3935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2550 -2.9185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3984 -4.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6840 -2.9185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6853 -0.8560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3984 1.6190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1129 -2.9185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1129 -0.4435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9708 0.3815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6840 0.3815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6840 -2.0935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1129 0.3815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3997 -0.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2550 -4.5685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6840 -0.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6853 -1.6810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3997 0.3815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1129 2.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5405 -2.5060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6675 -2.2040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8425 -3.6329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6840 -6.2185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8590 -5.3935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5090 -5.3935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5418 0.3815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1142 0.7940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6853 0.7940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8274 1.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8274 0.7940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6853 1.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1142 1.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3997 2.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 5 1 0
4 16 1 0
5 17 2 0
6 9 1 0
7 1 1 0
8 7 1 0
9 11 1 0
10 23 1 0
11 2 1 0
12 20 1 0
13 8 1 0
14 4 1 0
15 5 1 0
16 12 2 0
17 12 1 0
18 6 1 0
19 10 1 0
7 20 1 1
21 2 2 0
22 6 2 0
23 28 1 0
24 8 2 0
25 10 2 0
18 26 1 6
27 3 1 0
28 13 1 0
29 18 1 0
30 26 1 0
31 41 1 0
32 15 1 0
33 15 1 0
34 15 1 0
35 14 1 0
36 14 1 0
37 14 1 0
11 38 1 6
39 30 1 0
40 30 2 0
41 42 1 0
42 38 1 0
43 40 1 0
44 39 2 0
45 43 2 0
3 4 2 0
19 31 1 0
45 44 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 621.82Molecular Weight (Monoisotopic): 621.3890AlogP: 2.88#Rotatable Bonds: 6Polar Surface Area: 162.65Molecular Species: NEUTRALHBA: 6HBD: 6#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.65CX Basic pKa: 7.71CX LogP: 3.49CX LogD: 3.01Aromatic Rings: 2Heavy Atoms: 45QED Weighted: 0.29Np Likeness Score: 0.47
References 1. Haramura M, Okamachi A, Tsuzuki K, Yogo K, Ikuta M, Kozono T, Takanashi H, Murayama E.. (2002) Design and synthesis of motilin antagonists derived from the [1-4] fragment of porcine motilin., 45 (3): [PMID:11806718 ] [10.1021/jm010332u ]