The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Trifluoromethyl-phosphonic acid mono-[5-(5-fluoro-2,4-dioxo-3,4-dihydro-2H-pyrimidin-1-yl)-3-hydroxy-tetrahydro-furan-2-ylmethyl] ester ID: ALA3143930
Cas Number: 149894-51-9
PubChem CID: 90663650
Max Phase: Preclinical
Molecular Formula: C10H11F4N2O7P
Molecular Weight: 378.17
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=c1[nH]c(=O)n([C@H]2C[C@H](O)[C@@H](COP(=O)(O)C(F)(F)F)O2)cc1F
Standard InChI: InChI=1S/C10H11F4N2O7P/c11-4-2-16(9(19)15-8(4)18)7-1-5(17)6(23-7)3-22-24(20,21)10(12,13)14/h2,5-7,17H,1,3H2,(H,20,21)(H,15,18,19)/t5-,6+,7+/m0/s1
Standard InChI Key: GZDLQMAGLXOIPV-RRKCRQDMSA-N
Molfile:
RDKit 2D
24 25 0 0 0 0 0 0 0 0999 V2000
2.4539 -3.9321 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1183 -4.6858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6032 -5.3532 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9690 -3.2647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2744 -3.8459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2709 0.0674 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
3.7593 -4.5133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4237 -5.2670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2709 0.8924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2239 -2.4800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1440 -3.2647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5565 -1.9951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2709 -0.7576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8890 -2.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5565 -1.1701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2978 -4.7720 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0959 0.0674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9086 -5.9344 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5798 -4.4271 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.4459 0.0674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2709 1.7174 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.0959 0.8924 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.4459 0.8924 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.1044 -2.2251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 1 1 1
5 1 1 0
6 13 1 0
7 5 2 0
8 7 1 0
9 6 1 0
10 4 1 0
11 4 1 0
12 10 1 0
13 15 1 0
14 11 1 0
12 15 1 1
16 2 2 0
17 6 2 0
18 8 2 0
19 7 1 0
20 6 1 0
21 9 1 0
22 9 1 0
23 9 1 0
14 24 1 6
8 3 1 0
14 12 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 378.17Molecular Weight (Monoisotopic): 378.0240AlogP: 0.05#Rotatable Bonds: 4Polar Surface Area: 130.85Molecular Species: ACIDHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: -0.51CX Basic pKa: ┄CX LogP: 0.54CX LogD: -1.88Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.50Np Likeness Score: 0.45
References 1. Casara PJ, Jund KC, Clauss A, Nave J, Snyder RD. (1992) Synthesis of acid stable 5-o-fluoromethyl phosphonates of nucleosides. Evaluation as inhibitors of reverse transcriptase., 2 (2): [10.1016/S0960-894X(01)80437-6 ]