The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-{1-[4-Guanidino-1-(4-nitro-phenylcarbamoyl)-butylcarbamoyl]-2-methyl-propylcarbamoyl}-2-phenyl-ethyl)-benzamide ID: ALA3144127
PubChem CID: 16219051
Max Phase: Preclinical
Molecular Formula: C33H40N8O6
Molecular Weight: 644.73
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)Nc1ccc([N+](=O)[O-])cc1
Standard InChI: InChI=1S/C33H40N8O6/c1-21(2)28(40-31(44)27(20-22-10-5-3-6-11-22)39-29(42)23-12-7-4-8-13-23)32(45)38-26(14-9-19-36-33(34)35)30(43)37-24-15-17-25(18-16-24)41(46)47/h3-8,10-13,15-18,21,26-28H,9,14,19-20H2,1-2H3,(H,37,43)(H,38,45)(H,39,42)(H,40,44)(H4,34,35,36)/t26-,27-,28-/m0/s1
Standard InChI Key: QQVNCBCBFNWLJX-KCHLEUMXSA-N
Molfile:
RDKit 2D
47 49 0 0 0 0 0 0 0 0999 V2000
1.4698 -11.8894 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6219 -8.9148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0091 -8.5716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8017 -8.8004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7833 -7.8851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6404 -9.8300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4146 -9.1436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1888 -8.4571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0275 -9.4868 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3962 -8.2283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8293 -5.7114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8477 -9.6012 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0643 -11.3173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2348 -9.2580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6772 -11.6605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6680 -12.6902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4238 -5.1393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4238 -8.1139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9998 -9.6012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5759 -8.1139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8385 -10.6309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1980 -7.4275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5851 -7.0843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0275 -6.5122 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8569 -11.5461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8661 -10.5165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2532 -10.1732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0367 -5.4826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6127 -9.9444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4514 -10.9741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4606 -9.9444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4054 -7.1987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0367 -8.4571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1796 -6.5122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7925 -6.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4330 -7.0843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0183 -10.5165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4054 -10.1732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2072 -6.3978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8109 -7.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6311 -7.8851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5943 -6.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9814 -5.7114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0183 -7.5419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4146 -6.1690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1888 -5.4826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8201 -6.7410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 9 1 0
3 7 1 0
4 3 1 0
5 8 1 0
6 12 1 0
7 2 1 0
8 10 1 0
9 14 1 0
10 4 1 0
11 24 2 0
12 27 1 0
13 1 1 0
14 6 1 0
15 1 1 0
16 1 2 0
17 11 1 0
18 2 2 0
19 4 2 0
20 5 2 0
21 6 2 0
10 22 1 6
23 5 1 0
24 36 1 0
25 13 2 0
26 13 1 0
27 31 1 0
28 11 1 0
7 29 1 1
30 25 1 0
31 26 2 0
32 22 1 0
14 33 1 6
34 23 1 0
35 23 2 0
36 41 1 0
37 29 1 0
38 29 1 0
39 32 2 0
40 32 1 0
41 33 1 0
42 35 1 0
43 34 2 0
44 40 2 0
45 39 1 0
46 42 2 0
47 44 1 0
27 30 2 0
45 47 2 0
43 46 1 0
M CHG 2 1 1 15 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 644.73Molecular Weight (Monoisotopic): 644.3071AlogP: 2.25#Rotatable Bonds: 16Polar Surface Area: 223.94Molecular Species: BASEHBA: 7HBD: 6#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.69CX Basic pKa: 10.78CX LogP: 2.70CX LogD: 0.60Aromatic Rings: 3Heavy Atoms: 47QED Weighted: 0.04Np Likeness Score: -0.37
References 1. Lu T, Tomczuk B, Illig CR, Bone R, Murphy L, Spurlino J, Salemme FR, Soll RM.. (1998) In vitro evaluation and crystallographic analysis of a new class of selective, non-amide-based thrombin inhibitors., 8 (13): [PMID:9873397 ] [10.1016/s0960-894x(98)00290-x ]