The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{2-[2-(5-Dimethylamino-naphthalene-1-sulfonylamino)-acetylamino]-3-hydroxy-propionylamino}-5-guanidino-pentanoic acid amide ID: ALA3144155
PubChem CID: 10650317
Max Phase: Preclinical
Molecular Formula: C23H34N8O6S
Molecular Weight: 550.64
Molecule Type: Protein
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1cccc2c(S(=O)(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)cccc12
Standard InChI: InChI=1S/C23H34N8O6S/c1-31(2)18-9-3-7-15-14(18)6-4-10-19(15)38(36,37)28-12-20(33)29-17(13-32)22(35)30-16(21(24)34)8-5-11-27-23(25)26/h3-4,6-7,9-10,16-17,28,32H,5,8,11-13H2,1-2H3,(H2,24,34)(H,29,33)(H,30,35)(H4,25,26,27)/t16-,17-/m0/s1
Standard InChI Key: GNATZFCGYXHMGY-IRXDYDNUSA-N
Molfile:
RDKit 2D
38 39 0 0 0 0 0 0 0 0999 V2000
4.2891 -7.0653 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.5747 -6.6528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5760 -7.0653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8602 -7.0653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1457 -6.6528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8615 -7.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0036 -7.4778 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2904 -7.4778 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4313 -7.0653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5773 -7.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1470 -7.0653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0049 -6.2403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4325 -7.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7181 -7.0653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7016 -6.3508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8766 -7.7797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0049 -7.0653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5773 -8.3028 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7168 -6.6528 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5760 -6.2403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7194 -5.8278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4325 -8.3028 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8628 -7.0653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2917 -7.0653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2904 -5.8278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8615 -8.3028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1457 -5.8278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8602 -7.8903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5747 -5.8278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4313 -7.8903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1470 -8.7153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8602 -5.4153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1457 -8.3028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0023 -7.0653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7168 -5.8278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7194 -7.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1483 -7.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4338 -7.0653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 6 1 0
4 2 1 0
5 4 1 0
6 11 1 0
7 1 1 0
8 3 1 0
9 5 2 0
10 23 2 0
11 13 1 0
12 17 1 0
13 14 1 0
14 7 1 0
15 1 2 0
16 1 2 0
17 8 1 0
18 10 1 0
19 9 1 0
20 3 2 0
21 12 2 0
22 13 2 0
23 37 1 0
24 10 1 0
25 12 1 0
6 26 1 6
27 32 2 0
28 4 2 0
29 2 2 0
30 33 2 0
31 26 1 0
32 29 1 0
33 28 1 0
34 19 1 0
35 19 1 0
17 36 1 6
37 38 1 0
38 36 1 0
5 27 1 0
30 9 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 550.64Molecular Weight (Monoisotopic): 550.2322AlogP: -2.32#Rotatable Bonds: 14Polar Surface Area: 235.33Molecular Species: BASEHBA: 8HBD: 7#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 10#RO5 Violations (Lipinski): 3CX Acidic pKa: 9.84CX Basic pKa: 10.90CX LogP: -3.00CX LogD: -4.74Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.08Np Likeness Score: -0.42
References 1. Prokai L, Prokai-Tatrai K, Zharikova A, Li X, Rocca JR.. (2001) Combinatorial lead optimization of a neuropeptide FF antagonist., 44 (10): [PMID:11334572 ] [10.1021/jm000512o ]