The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[3-{4-[Bis-(2-chloro-ethyl)-amino]-phenyl}-2-(2-{2-[2-diallylamino-3-(4-hydroxy-phenyl)-propionylamino]-2-methyl-propionylamino}-2-methyl-propionylamino)-propionylamino]-4-methyl-pentanoic acid ID: ALA3144363
PubChem CID: 13893385
Max Phase: Preclinical
Molecular Formula: C42H60Cl2N6O7
Molecular Weight: 831.88
Molecule Type: Protein
Associated Items:
Names and Identifiers Canonical SMILES: C=CCN(CC=C)[C@@H](Cc1ccc(O)cc1)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)N[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)N[C@@H](CC(C)C)C(=O)O
Standard InChI: InChI=1S/C42H60Cl2N6O7/c1-9-21-50(22-10-2)35(27-30-13-17-32(51)18-14-30)37(53)47-42(7,8)40(57)48-41(5,6)39(56)46-33(36(52)45-34(38(54)55)25-28(3)4)26-29-11-15-31(16-12-29)49(23-19-43)24-20-44/h9-18,28,33-35,51H,1-2,19-27H2,3-8H3,(H,45,52)(H,46,56)(H,47,53)(H,48,57)(H,54,55)/t33-,34-,35-/m0/s1
Standard InChI Key: RPJYDHKYCWHHOP-IMKBVMFZSA-N
Molfile:
RDKit 2D
57 58 0 0 0 0 0 0 0 0999 V2000
-0.1378 -0.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0084 -0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1586 -0.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3047 -0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5804 -0.4134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7223 -0.8267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8768 -0.4134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0187 -0.8267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2944 -0.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4446 -0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8518 -0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5908 -0.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7410 -0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4550 -0.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5657 -0.8267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1378 -1.6534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3319 -3.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0084 0.4134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1586 -1.6534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3047 0.4134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8518 0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5908 -1.6534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9206 -3.9749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1732 -0.4134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7410 0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5448 -2.5929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5385 -3.6075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2880 -2.0668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0020 -0.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2880 -2.8935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7160 -0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1753 -2.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5657 0.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4550 -1.6534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.0020 1.6617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9561 -2.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9540 -3.0230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2880 0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5657 1.6617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2797 2.0751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9937 0.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5657 -1.6534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2880 -0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0792 -6.1544 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.1001 -4.1252 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.7160 2.0668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8768 -1.5407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7035 -1.5407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0250 0.1754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6805 -0.0919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4550 0.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7076 -4.7766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7180 -3.7620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2984 -4.3382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2922 -5.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1732 0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4550 1.6534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 9 1 0
3 10 1 0
4 12 1 0
5 1 1 0
6 2 1 0
7 3 1 0
8 4 1 0
9 5 1 0
10 6 1 0
11 1 1 0
12 7 1 0
13 8 1 0
14 13 1 0
15 11 1 0
16 1 2 0
17 27 2 0
18 2 2 0
19 3 2 0
20 4 2 0
11 21 1 1
12 22 1 6
23 17 1 0
24 14 2 0
13 25 1 1
26 36 2 0
27 37 1 0
28 42 1 0
29 43 1 0
30 28 2 0
31 29 2 0
32 22 1 0
33 21 1 0
34 14 1 0
35 40 2 0
36 32 1 0
37 32 2 0
38 33 1 0
39 33 2 0
40 39 1 0
41 38 2 0
42 15 1 0
43 15 1 0
44 55 1 0
45 54 1 0
46 35 1 0
47 9 1 0
48 9 1 0
49 10 1 0
50 10 1 0
51 25 1 0
52 23 1 0
53 23 1 0
54 53 1 0
55 52 1 0
56 51 1 0
57 51 1 0
41 35 1 0
26 17 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 831.88Molecular Weight (Monoisotopic): 830.3901AlogP: 4.39#Rotatable Bonds: 25Polar Surface Area: 180.41Molecular Species: ACIDHBA: 8HBD: 6#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 4.10CX Basic pKa: 6.57CX LogP: 3.64CX LogD: 2.97Aromatic Rings: 2Heavy Atoms: 57QED Weighted: 0.06Np Likeness Score: -0.24
References 1. Lovett JA, Portoghese PS.. (1987) Synthesis and evaluation of melphalan-containing N,N-dialkylenkephalin analogues as irreversible antagonists of the delta opioid receptor., 30 (9): [PMID:3041000 ] [10.1021/jm00392a025 ]