2-{2-[2-(4-Chloro-phenyl)-acetylamino]-propionylamino}-3-(1H-indol-3-yl)-N-phenethyl-propionamide

ID: ALA3144489

PubChem CID: 90663956

Max Phase: Preclinical

Molecular Formula: C30H31ClN4O3

Molecular Weight: 531.06

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H](NC(=O)Cc1ccc(Cl)cc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCc1ccccc1

Standard InChI:  InChI=1S/C30H31ClN4O3/c1-20(34-28(36)17-22-11-13-24(31)14-12-22)29(37)35-27(18-23-19-33-26-10-6-5-9-25(23)26)30(38)32-16-15-21-7-3-2-4-8-21/h2-14,19-20,27,33H,15-18H2,1H3,(H,32,38)(H,34,36)(H,35,37)/t20-,27-/m0/s1

Standard InChI Key:  OZOUGSZITCUGCW-DCFHFQCYSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
    4.7731   -7.9598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9166   -6.7223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4674   -8.2374    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2021   -6.3098    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0195   -7.6243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4876   -6.7223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7731   -6.3098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0600   -6.3098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6869   -8.7803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4876   -7.5473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3455   -6.7223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8799   -8.9518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6310   -6.3098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9166   -7.5473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7731   -5.4848    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0600   -5.4848    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0587   -6.7223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7744   -6.7223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4889   -6.3098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9179   -5.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6323   -5.0723    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.2034   -5.0723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9179   -6.3098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4889   -5.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2034   -6.7223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3442   -6.3098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9153   -6.3098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2389   -9.3934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6310   -5.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6250   -9.7365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6297   -6.7223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9153   -5.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2008   -6.7223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9840  -10.1780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1770  -10.3495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4863   -6.3098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2008   -5.0723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4863   -5.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  4  1  0
  3  5  1  0
  4  6  1  0
  5  1  2  0
  6 10  1  1
  7  6  1  0
  8 11  1  0
  9  1  1  0
 10  1  1  0
 11 13  1  0
 12  9  2  0
 13  2  1  0
 14  2  2  0
 15  7  2  0
 16  8  2  0
 17  7  1  0
 18  8  1  0
 19 18  1  0
 20 23  2  0
 21 20  1  0
 22 24  2  0
 23 25  1  0
 24 19  1  0
 25 19  2  0
 26 17  1  0
 27 31  1  0
 28  9  1  0
 13 29  1  6
 30 12  1  0
 31 26  1  0
 32 27  2  0
 33 27  1  0
 34 28  2  0
 35 34  1  0
 36 33  2  0
 37 32  1  0
 38 36  1  0
  3 12  1  0
 30 35  2  0
 37 38  2  0
 22 20  1  0
M  END

Alternative Forms

Associated Targets(Human)

NMBR Tchem Neuromedin B receptor (236 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GRPR Tchem Gastrin releasing peptide receptor (289 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BRS3 Tchem Bombesin receptor subtype-3 (700 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 531.06Molecular Weight (Monoisotopic): 530.2085AlogP: 3.95#Rotatable Bonds: 11
Polar Surface Area: 103.09Molecular Species: NEUTRALHBA: 3HBD: 4
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.22CX Basic pKa: CX LogP: 4.33CX LogD: 4.33
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.24Np Likeness Score: -0.64

References

1. Weber D, Berger C, Eickelmann P, Antel J, Kessler H..  (2003)  Design of selective peptidomimetic agonists for the human orphan receptor BRS-3.,  46  (10): [PMID:12723954] [10.1021/jm0210921]

Source