N-[2-(1H-Indol-3-yl)-1-phenethylcarbamoyl-ethyl]-2-phenethylamino-propionamide

ID: ALA3144491

PubChem CID: 90663958

Max Phase: Preclinical

Molecular Formula: C30H34N4O2

Molecular Weight: 482.63

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H](NCCc1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCc1ccccc1

Standard InChI:  InChI=1S/C30H34N4O2/c1-22(31-18-16-23-10-4-2-5-11-23)29(35)34-28(20-25-21-33-27-15-9-8-14-26(25)27)30(36)32-19-17-24-12-6-3-7-13-24/h2-15,21-22,28,31,33H,16-20H2,1H3,(H,32,36)(H,34,35)/t22-,28-/m0/s1

Standard InChI Key:  CVEMWPNQHFKFCM-DWACAAAGSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    5.7078   -8.2911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8512   -7.0536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4021   -8.5686    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1367   -6.6411    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9541   -7.9555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4222   -7.0536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7078   -6.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6215   -9.1115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4222   -7.8786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8146   -9.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8512   -7.8786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7078   -5.8161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5657   -6.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9933   -7.0536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2801   -7.0536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2788   -6.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9946   -6.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8499   -6.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4235   -6.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1736   -9.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5596  -10.0677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7091   -7.0536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5644   -7.0536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5657   -5.8161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8499   -5.8161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1354   -7.0536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1380   -7.0536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4235   -5.8161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9186  -10.5093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1117  -10.6808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4210   -6.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8525   -6.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1380   -5.4036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1354   -5.4036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4210   -5.8161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8525   -5.8161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  4  1  0
  3  5  1  0
  4  6  1  0
  5  1  2  0
  6  9  1  1
  7  6  1  0
  8  1  1  0
  9  1  1  0
 10  8  2  0
 11  2  2  0
 12  7  2  0
 13  2  1  0
 14  7  1  0
 15 13  1  0
 16 14  1  0
 17 15  1  0
 18 23  1  0
 19 22  1  0
 20  8  1  0
 21 10  1  0
 22 17  1  0
 23 16  1  0
 13 24  1  6
 25 18  1  0
 26 18  2  0
 27 19  2  0
 28 19  1  0
 29 20  2  0
 30 29  1  0
 31 26  1  0
 32 27  1  0
 33 28  2  0
 34 25  2  0
 35 31  2  0
 36 33  1  0
  3 10  1  0
 21 30  2  0
 35 34  1  0
 32 36  2  0
M  END

Associated Targets(Human)

NMBR Tchem Neuromedin B receptor (236 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GRPR Tchem Gastrin releasing peptide receptor (289 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BRS3 Tchem Bombesin receptor subtype-3 (700 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 482.63Molecular Weight (Monoisotopic): 482.2682AlogP: 3.77#Rotatable Bonds: 12
Polar Surface Area: 86.02Molecular Species: NEUTRALHBA: 3HBD: 4
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.83CX Basic pKa: 8.45CX LogP: 4.52CX LogD: 3.43
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.25Np Likeness Score: -0.31

References

1. Weber D, Berger C, Eickelmann P, Antel J, Kessler H..  (2003)  Design of selective peptidomimetic agonists for the human orphan receptor BRS-3.,  46  (10): [PMID:12723954] [10.1021/jm0210921]

Source