2-(4-Chloro-benzylamino)-N-[2-(1H-indol-3-yl)-1-phenethylcarbamoyl-ethyl]-propionamide

ID: ALA3144492

PubChem CID: 90663959

Max Phase: Preclinical

Molecular Formula: C29H31ClN4O2

Molecular Weight: 503.05

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H](NCc1ccc(Cl)cc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCc1ccccc1

Standard InChI:  InChI=1S/C29H31ClN4O2/c1-20(32-18-22-11-13-24(30)14-12-22)28(35)34-27(17-23-19-33-26-10-6-5-9-25(23)26)29(36)31-16-15-21-7-3-2-4-8-21/h2-14,19-20,27,32-33H,15-18H2,1H3,(H,31,36)(H,34,35)/t20-,27-/m0/s1

Standard InChI Key:  IIKQMMXJROTBPV-DCFHFQCYSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    5.0711   -7.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2145   -6.0276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7654   -7.5427    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5001   -5.6151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3175   -6.9296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7856   -6.0276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0711   -5.6151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9849   -8.0856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7856   -6.8526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1779   -8.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6435   -6.0276    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2145   -6.8526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9290   -5.6151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0711   -4.7901    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3567   -6.0276    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3580   -5.6151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5014   -6.8526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0724   -6.0276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2158   -7.2651    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.5014   -6.0276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7869   -7.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7869   -5.6151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0724   -6.8526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6422   -5.6151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2133   -5.6151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5369   -8.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9230   -9.0418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9277   -6.0276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9290   -4.7901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2133   -4.7901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4988   -6.0276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2820   -9.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4750   -9.6548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7843   -5.6151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4988   -4.3776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7843   -4.7901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  4  1  0
  3  5  1  0
  4  6  1  0
  5  1  2  0
  6  9  1  1
  7  6  1  0
  8  1  1  0
  9  1  1  0
 10  8  2  0
 11 13  1  0
 12  2  2  0
 13  2  1  0
 14  7  2  0
 15  7  1  0
 16 11  1  0
 17 21  2  0
 18 16  1  0
 19 17  1  0
 20 22  2  0
 21 23  1  0
 22 18  1  0
 23 18  2  0
 24 15  1  0
 25 28  1  0
 26  8  1  0
 27 10  1  0
 28 24  1  0
 13 29  1  6
 30 25  2  0
 31 25  1  0
 32 26  2  0
 33 32  1  0
 34 31  2  0
 35 30  1  0
 36 34  1  0
  3 10  1  0
 27 33  2  0
 35 36  2  0
 20 17  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

NMBR Tchem Neuromedin B receptor (236 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GRPR Tchem Gastrin releasing peptide receptor (289 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BRS3 Tchem Bombesin receptor subtype-3 (700 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 503.05Molecular Weight (Monoisotopic): 502.2136AlogP: 4.39#Rotatable Bonds: 11
Polar Surface Area: 86.02Molecular Species: NEUTRALHBA: 3HBD: 4
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.54CX Basic pKa: 7.61CX LogP: 4.83CX LogD: 4.41
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.25Np Likeness Score: -0.67

References

1. Weber D, Berger C, Eickelmann P, Antel J, Kessler H..  (2003)  Design of selective peptidomimetic agonists for the human orphan receptor BRS-3.,  46  (10): [PMID:12723954] [10.1021/jm0210921]

Source