The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(1H-Indol-3-yl)-N-phenethyl-2-[2-(2-1,2,3,4-tetrahydro-isoquinolin-1-yl-acetylamino)-propionylamino]-propionamide ID: ALA3144496
PubChem CID: 90663963
Max Phase: Preclinical
Molecular Formula: C33H37N5O3
Molecular Weight: 551.69
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](NC(=O)CC1NCCc2ccccc21)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCc1ccccc1
Standard InChI: InChI=1S/C33H37N5O3/c1-22(37-31(39)20-29-26-12-6-5-11-24(26)16-18-34-29)32(40)38-30(19-25-21-36-28-14-8-7-13-27(25)28)33(41)35-17-15-23-9-3-2-4-10-23/h2-14,21-22,29-30,34,36H,15-20H2,1H3,(H,35,41)(H,37,39)(H,38,40)/t22-,29?,30-/m0/s1
Standard InChI Key: CFKSTPUYLNWQPP-WWFTWHPHSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
4.6794 -8.2653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8229 -7.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3737 -8.5429 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1084 -6.6153 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6807 -7.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9258 -7.9298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9663 -6.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3952 -6.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3939 -7.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6794 -6.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5932 -9.0858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3939 -7.8528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2518 -7.0278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3952 -5.7903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1097 -7.0278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7862 -9.2573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5373 -6.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8229 -7.8528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9663 -5.7903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6794 -5.7903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1097 -5.3778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9650 -7.0278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8242 -6.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2505 -6.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8216 -6.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1452 -9.6989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6807 -5.3778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8242 -5.7903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5373 -5.7903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5313 -10.0420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1097 -4.5528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5360 -7.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8216 -5.7903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1071 -7.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8903 -10.4835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6807 -4.5528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3952 -4.1403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0833 -10.6551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3926 -6.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1071 -5.3778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3926 -5.7903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 4 1 0
3 6 1 0
4 9 1 0
5 7 1 0
6 1 2 0
7 13 1 0
8 5 1 0
9 12 1 1
10 9 1 0
11 1 1 0
12 1 1 0
13 17 1 0
14 8 1 0
15 8 1 0
16 11 2 0
17 2 1 0
18 2 2 0
19 7 2 0
20 10 2 0
21 14 2 0
22 10 1 0
23 15 1 0
24 22 1 0
25 32 1 0
26 11 1 0
27 14 1 0
28 23 1 0
17 29 1 6
30 16 1 0
31 21 1 0
32 24 1 0
33 25 2 0
34 25 1 0
35 26 2 0
36 27 2 0
37 36 1 0
38 35 1 0
39 34 2 0
40 33 1 0
41 39 1 0
3 16 1 0
30 38 2 0
40 41 2 0
28 21 1 0
31 37 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 551.69Molecular Weight (Monoisotopic): 551.2896AlogP: 3.34#Rotatable Bonds: 11Polar Surface Area: 115.12Molecular Species: NEUTRALHBA: 4HBD: 5#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.45CX Basic pKa: 8.45CX LogP: 3.46CX LogD: 2.38Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.20Np Likeness Score: -0.18
References 1. Weber D, Berger C, Eickelmann P, Antel J, Kessler H.. (2003) Design of selective peptidomimetic agonists for the human orphan receptor BRS-3., 46 (10): [PMID:12723954 ] [10.1021/jm0210921 ]