The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[2-(4-Chloro-phenyl)-acetylamino]-pentanedioic acid 5-amide 1-{[2-(1H-indol-3-yl)-1-phenethylcarbamoyl-ethyl]-amide} ID: ALA3144498
PubChem CID: 90663965
Max Phase: Preclinical
Molecular Formula: C32H34ClN5O4
Molecular Weight: 588.11
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)CC[C@H](NC(=O)Cc1ccc(Cl)cc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCc1ccccc1
Standard InChI: InChI=1S/C32H34ClN5O4/c33-24-12-10-22(11-13-24)18-30(40)37-27(14-15-29(34)39)32(42)38-28(19-23-20-36-26-9-5-4-8-25(23)26)31(41)35-17-16-21-6-2-1-3-7-21/h1-13,20,27-28,36H,14-19H2,(H2,34,39)(H,35,41)(H,37,40)(H,38,42)/t27-,28-/m0/s1
Standard InChI Key: QXYSJPMGIVOYKS-NSOVKSMOSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
4.8345 -7.2020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2931 -6.9181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5260 -6.9378 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8014 -6.2557 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2762 -6.5946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9818 -6.3503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4901 -5.6879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4240 -7.3913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4293 -7.9207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6540 -7.1074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6044 -7.4859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1127 -6.8235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6206 -7.7574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5879 -5.2147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9653 -7.6752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8179 -4.9308 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7518 -6.6342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0962 -4.5522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6706 -5.7825 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4405 -6.0664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9157 -8.0537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2601 -5.9718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4074 -5.1200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7353 -7.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3744 -7.7698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1939 -7.6752 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.8826 -7.1074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0466 -8.5269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0631 -7.2020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2270 -8.6215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1788 -5.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8675 -4.5522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6923 -8.7026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0749 -8.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3593 -5.2147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1954 -3.7952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0480 -4.6469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1465 -9.3213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3379 -9.1581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5563 -3.9844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7036 -3.1327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8841 -3.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 4 1 0
3 5 1 0
4 6 1 0
5 1 2 0
6 10 1 1
7 6 1 0
8 11 1 0
9 1 1 0
10 1 1 0
11 12 1 0
12 2 1 0
13 9 2 0
14 22 1 0
15 2 2 0
16 7 2 0
17 8 2 0
18 14 2 0
19 7 1 0
12 20 1 6
21 8 1 0
22 20 1 0
23 14 1 0
24 21 1 0
25 28 2 0
26 25 1 0
27 29 2 0
28 30 1 0
29 24 1 0
30 24 2 0
31 19 1 0
32 35 1 0
33 9 1 0
34 13 1 0
35 31 1 0
36 32 2 0
37 32 1 0
38 33 2 0
39 38 1 0
40 37 2 0
41 36 1 0
42 40 1 0
3 13 1 0
34 39 2 0
41 42 2 0
27 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 588.11Molecular Weight (Monoisotopic): 587.2299AlogP: 3.20#Rotatable Bonds: 14Polar Surface Area: 146.18Molecular Species: NEUTRALHBA: 4HBD: 5#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.17CX Basic pKa: ┄CX LogP: 3.17CX LogD: 3.17Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.15Np Likeness Score: -0.48
References 1. Weber D, Berger C, Eickelmann P, Antel J, Kessler H.. (2003) Design of selective peptidomimetic agonists for the human orphan receptor BRS-3., 46 (10): [PMID:12723954 ] [10.1021/jm0210921 ]