The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-1H-Indol-2-yl-acetylamino)-pentanedioic acid 5-amide 1-{[2-(1H-indol-3-yl)-1-phenethylcarbamoyl-ethyl]-amide} ID: ALA3144499
PubChem CID: 90663966
Max Phase: Preclinical
Molecular Formula: C34H36N6O4
Molecular Weight: 592.70
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)CC[C@H](NC(=O)Cc1cc2ccccc2[nH]1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCc1ccccc1
Standard InChI: InChI=1S/C34H36N6O4/c35-31(41)15-14-29(39-32(42)20-25-18-23-10-4-6-12-27(23)38-25)34(44)40-30(19-24-21-37-28-13-7-5-11-26(24)28)33(43)36-17-16-22-8-2-1-3-9-22/h1-13,18,21,29-30,37-38H,14-17,19-20H2,(H2,35,41)(H,36,43)(H,39,42)(H,40,44)/t29-,30-/m0/s1
Standard InChI Key: JRPZUJBBTQFMSA-KYJUHHDHSA-N
Molfile:
RDKit 2D
44 48 0 0 0 0 0 0 0 0999 V2000
5.5107 -3.6148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3034 -9.3352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6241 -2.7977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8979 -6.9326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9692 -9.2910 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6997 -7.7335 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6524 -8.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6985 -3.7595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9071 -4.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2942 -8.3055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1052 -4.1869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0868 -8.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0226 -10.1109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0960 -9.1064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5015 -5.5598 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8820 -2.4373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3099 -3.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3034 -6.3606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1980 -10.0836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1236 -6.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6905 -6.7038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1144 -5.2165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6813 -8.6487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9255 -7.0470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2850 -7.2759 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5107 -6.5894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9163 -6.0174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5292 -5.6742 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0776 -7.0470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0684 -6.0174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4112 -10.8387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6531 -1.6447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5091 -2.8336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7621 -10.7840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2758 -6.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6629 -6.5894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2666 -5.2165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9753 -11.5391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8523 -1.4465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2803 -2.0410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1507 -11.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0592 -4.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4555 -6.3606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6537 -5.5598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 14 1 0
3 1 1 0
4 18 1 0
5 7 1 0
6 4 1 0
7 2 2 0
8 1 2 0
9 11 1 0
10 6 1 0
11 1 1 0
12 10 1 0
13 2 1 0
10 14 1 6
15 9 1 0
16 3 1 0
17 8 1 0
18 15 1 0
19 13 2 0
20 27 1 0
21 4 2 0
22 9 2 0
23 12 2 0
24 20 2 0
25 12 1 0
18 26 1 6
27 26 1 0
28 20 1 0
29 25 1 0
30 35 1 0
31 13 1 0
32 16 1 0
33 17 1 0
34 19 1 0
35 29 1 0
36 30 1 0
37 30 2 0
38 31 2 0
39 32 2 0
40 33 2 0
41 38 1 0
42 37 1 0
43 36 2 0
44 42 2 0
17 16 2 0
40 39 1 0
5 19 1 0
34 41 2 0
44 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 592.70Molecular Weight (Monoisotopic): 592.2798AlogP: 3.03#Rotatable Bonds: 14Polar Surface Area: 161.97Molecular Species: NEUTRALHBA: 4HBD: 6#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.34CX Basic pKa: ┄CX LogP: 2.58CX LogD: 2.58Aromatic Rings: 5Heavy Atoms: 44QED Weighted: 0.12Np Likeness Score: -0.39
References 1. Weber D, Berger C, Eickelmann P, Antel J, Kessler H.. (2003) Design of selective peptidomimetic agonists for the human orphan receptor BRS-3., 46 (10): [PMID:12723954 ] [10.1021/jm0210921 ]