3-(1H-Indol-3-yl)-N-phenethyl-2-(2-phenylacetylamino-propionylamino)-propionamide

ID: ALA3144501

PubChem CID: 90663968

Max Phase: Preclinical

Molecular Formula: C30H32N4O3

Molecular Weight: 496.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H](NC(=O)Cc1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCc1ccccc1

Standard InChI:  InChI=1S/C30H32N4O3/c1-21(33-28(35)18-23-12-6-3-7-13-23)29(36)34-27(19-24-20-32-26-15-9-8-14-25(24)26)30(37)31-17-16-22-10-4-2-5-11-22/h2-15,20-21,27,32H,16-19H2,1H3,(H,31,37)(H,33,35)(H,34,36)/t21-,27-/m0/s1

Standard InChI Key:  PNHRJAUECMFZID-IDISGSTGSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    5.0527   -7.9733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1962   -6.7358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7470   -8.2508    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4817   -6.3233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2991   -7.6377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7672   -6.7358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0527   -6.3233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3396   -6.3233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9665   -8.7938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7672   -7.5608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6251   -6.7358    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1595   -8.9653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9106   -6.3233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1962   -7.5608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0527   -5.4983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3396   -5.4983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3383   -6.7358    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0540   -6.7358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7685   -6.3233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6238   -6.3233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1949   -6.3233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5185   -9.4069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9106   -5.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9046   -9.7499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9093   -6.7358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4830   -6.7358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7685   -5.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1949   -5.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4804   -6.7358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2636  -10.1915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4566  -10.3630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7659   -6.3233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1975   -6.3233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4830   -5.0858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4804   -5.0858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7659   -5.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1975   -5.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  4  1  0
  3  5  1  0
  4  6  1  0
  5  1  2  0
  6 10  1  1
  7  6  1  0
  8 11  1  0
  9  1  1  0
 10  1  1  0
 11 13  1  0
 12  9  2  0
 13  2  1  0
 14  2  2  0
 15  7  2  0
 16  8  2  0
 17  7  1  0
 18  8  1  0
 19 18  1  0
 20 17  1  0
 21 25  1  0
 22  9  1  0
 13 23  1  6
 24 12  1  0
 25 20  1  0
 26 19  2  0
 27 19  1  0
 28 21  2  0
 29 21  1  0
 30 22  2  0
 31 30  1  0
 32 29  2  0
 33 26  1  0
 34 27  2  0
 35 28  1  0
 36 32  1  0
 37 34  1  0
  3 12  1  0
 24 31  2  0
 35 36  2  0
 33 37  2  0
M  END

Alternative Forms

Associated Targets(Human)

NMBR Tchem Neuromedin B receptor (236 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GRPR Tchem Gastrin releasing peptide receptor (289 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BRS3 Tchem Bombesin receptor subtype-3 (700 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 496.61Molecular Weight (Monoisotopic): 496.2474AlogP: 3.30#Rotatable Bonds: 11
Polar Surface Area: 103.09Molecular Species: NEUTRALHBA: 3HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.44CX Basic pKa: CX LogP: 3.72CX LogD: 3.72
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.26Np Likeness Score: -0.47

References

1. Weber D, Berger C, Eickelmann P, Antel J, Kessler H..  (2003)  Design of selective peptidomimetic agonists for the human orphan receptor BRS-3.,  46  (10): [PMID:12723954] [10.1021/jm0210921]

Source