The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-cyano-3-(5-hydroxy-1-(4-(4-methoxyphenyl)thiazol-2-yl)-3-methyl-1H-pyrazol-4-yl)-3-phenylpropanamide ID: ALA3144706
PubChem CID: 4593175
Max Phase: Preclinical
Molecular Formula: C24H21N5O3S
Molecular Weight: 459.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2csc(-n3[nH]c(C)c(C(c4ccccc4)C(C#N)C(N)=O)c3=O)n2)cc1
Standard InChI: InChI=1S/C24H21N5O3S/c1-14-20(21(18(12-25)22(26)30)16-6-4-3-5-7-16)23(31)29(28-14)24-27-19(13-33-24)15-8-10-17(32-2)11-9-15/h3-11,13,18,21,28H,1-2H3,(H2,26,30)
Standard InChI Key: STVVMQJSKLQUPQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-4.2177 -22.1393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2189 -22.9666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5040 -23.3795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7877 -22.9661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7906 -22.1357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5058 -21.7267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0777 -21.7206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3618 -22.1303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7968 -20.4859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5111 -20.9015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3680 -20.4805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0815 -20.8986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6550 -20.0583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2683 -22.9538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4608 -23.1223 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0510 -22.4063 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6053 -21.7955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8780 -23.5096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4346 -20.9884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7691 -22.3170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3237 -22.9238 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.0760 -22.5855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9866 -21.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1790 -21.5971 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5974 -21.2109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3820 -21.4673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9925 -20.9138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8181 -20.1065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0277 -19.8560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4206 -20.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4281 -19.5514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2141 -19.8022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8014 -19.6615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7 12 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 8 1 0
14 18 1 0
12 9 1 0
17 19 2 0
4 5 2 0
16 20 1 0
20 21 1 0
2 3 2 0
9 33 1 0
9 10 2 0
5 6 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 20 2 0
6 1 2 0
23 25 1 0
11 12 1 0
25 26 2 0
1 2 1 0
26 27 1 0
11 13 3 0
27 28 2 0
8 14 2 0
28 29 1 0
5 7 1 0
29 30 2 0
30 25 1 0
3 4 1 0
28 31 1 0
7 8 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.53Molecular Weight (Monoisotopic): 459.1365AlogP: 3.36#Rotatable Bonds: 7Polar Surface Area: 126.79Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.56CX Basic pKa: 0.38CX LogP: 2.87CX LogD: 2.11Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.44Np Likeness Score: -1.05
References 1. Yamazaki K, Kusunose N, Fujita K, Sato H, Asano S, Dan A, Kanaoka M.. (2006) Identification of phosphodiesterase-1 and 5 dual inhibitors by a ligand-based virtual screening optimized for lead evolution., 16 (5): [PMID:16337379 ] [10.1016/j.bmcl.2005.11.046 ]