The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
DNDI1417900 ID: ALA3145326
PubChem CID: 20898752
Max Phase: Preclinical
Molecular Formula: C18H18ClN3O3S
Molecular Weight: 391.88
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1sc(-n2[nH]c(C)c(Cc3ccc(Cl)cc3)c2=O)nc1C
Standard InChI: InChI=1S/C18H18ClN3O3S/c1-4-25-17(24)15-11(3)20-18(26-15)22-16(23)14(10(2)21-22)9-12-5-7-13(19)8-6-12/h5-8,21H,4,9H2,1-3H3
Standard InChI Key: XKFHRBJFFPXMCV-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 28 0 0 0 0 0 0 0 0999 V2000
7.3823 -6.9008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1698 -6.6497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1277 -7.6883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3024 -7.6883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7151 -6.4193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5110 -6.6497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8335 -7.1381 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.4277 -5.8622 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2564 -5.8622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0513 -6.9008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2916 -6.9076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8175 -8.3588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6161 -8.3588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4601 -7.7124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3333 -9.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9071 -6.3574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3651 -10.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7344 -5.1985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8774 -10.9347 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.2672 -6.6497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0307 -9.7723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1449 -8.8747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6573 -9.5144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5430 -10.4154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7352 -5.5493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3474 -5.0025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 3 1 0
5 1 1 0
6 7 1 0
7 2 1 0
8 2 2 0
9 8 1 0
10 5 1 0
11 6 1 0
12 4 1 0
13 3 2 0
14 11 2 0
15 12 1 0
16 11 1 0
17 23 1 0
18 9 1 0
19 17 1 0
20 10 1 0
21 15 2 0
22 15 1 0
23 22 2 0
24 21 1 0
25 16 1 0
26 25 1 0
4 10 2 0
9 6 2 0
17 24 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 391.88Molecular Weight (Monoisotopic): 391.0757AlogP: 3.66#Rotatable Bonds: 5Polar Surface Area: 76.98Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.60CX Basic pKa: ┄CX LogP: 3.82CX LogD: 3.09Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.67Np Likeness Score: -1.60
References 1. Melissa L. Sykes, Jonathan B. Baell, Marcel Kaiser, Eric Chatelain, Danny Ganame, Jean-Robert Ioset, Vicky M Avery. WEHI/Eskitis Trypanosoma b. brucei screening data, [10.6019/CHEMBL2094269 ]