7-Methoxy-naphthalene-2-sulfonic acid [(S)-1-(1-amino-6-methoxy-isoquinolin-7-ylmethyl)-2-oxo-pyrrolidin-3-yl]-amide

ID: ALA314909

PubChem CID: 15546795

Max Phase: Preclinical

Molecular Formula: C26H26N4O5S

Molecular Weight: 506.58

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2ccc(S(=O)(=O)N[C@H]3CCN(Cc4cc5c(N)nccc5cc4OC)C3=O)cc2c1

Standard InChI:  InChI=1S/C26H26N4O5S/c1-34-20-5-3-16-4-6-21(12-18(16)11-20)36(32,33)29-23-8-10-30(26(23)31)15-19-13-22-17(14-24(19)35-2)7-9-28-25(22)27/h3-7,9,11-14,23,29H,8,10,15H2,1-2H3,(H2,27,28)/t23-/m0/s1

Standard InChI Key:  RTZPSFNQGNYELJ-QHCPKHFHSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  1  0  0  0  0  0999 V2000
    3.5042   -0.8167    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.4542   -0.8167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9667   -0.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4792   -0.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9792   -0.5167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4292   -0.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0167   -0.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5958   -0.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0833   -0.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9417   -0.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1083   -0.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4292   -1.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5958   -1.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0292   -0.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4792   -1.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5167   -0.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1792   -1.4417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8042   -1.4792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0708   -1.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4542   -1.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6208   -0.8292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9667    0.0833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0292    0.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5542   -0.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0167    0.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5167    0.3708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5417    0.3708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1208    0.0708    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0667   -0.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6208   -1.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9417   -1.7042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0542    0.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1083   -1.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5667   -0.8042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9417   -2.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5667   -1.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  4  5  1  1
  5  1  1  0
  6 10  1  0
  7  1  1  0
  8  9  1  0
  9  6  2  0
 10  2  1  0
 11  8  2  0
 12  6  1  0
 13 19  1  0
 14 16  2  0
 15  4  1  0
 16  7  1  0
 17  1  2  0
 18  1  2  0
 19 12  2  0
 20 15  1  0
 21 11  1  0
 22  3  2  0
 23 26  2  0
 24 14  1  0
 25  7  2  0
 26 25  1  0
 27 23  1  0
 28 11  1  0
 29 24  2  0
 30 33  1  0
 31 12  1  0
 32 27  2  0
 33 13  2  0
 34 29  1  0
 35 31  1  0
 36 34  1  0
 14 23  1  0
  2 20  1  0
 29 32  1  0
 13  8  1  0
 21 30  2  0
M  END

Associated Targets(non-human)

F10 Coagulation factor X (201 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.58Molecular Weight (Monoisotopic): 506.1624AlogP: 3.07#Rotatable Bonds: 7
Polar Surface Area: 123.85Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.04CX Basic pKa: 7.85CX LogP: 1.96CX LogD: 1.41
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.39Np Likeness Score: -0.72

References

1. Choi-Sledeski YM, Becker MR, Green DM, Davis R, Ewing WR, Mason HJ, Ly C, Spada A, Liang G, Cheney D, Barton J, Chu V, Brown K, Colussi D, Bentley R, Leadley R, Dunwiddie C, Pauls HW..  (1999)  Aminoisoquinolines: design and synthesis of an orally active benzamidine isostere for the inhibition of factor XA.,  (17): [PMID:10498204] [10.1016/s0960-894x(99)00421-7]

Source