The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-Methoxy-naphthalene-2-sulfonic acid [(S)-1-(1-amino-6-methoxy-isoquinolin-7-ylmethyl)-2-oxo-pyrrolidin-3-yl]-amide ID: ALA314909
PubChem CID: 15546795
Max Phase: Preclinical
Molecular Formula: C26H26N4O5S
Molecular Weight: 506.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2ccc(S(=O)(=O)N[C@H]3CCN(Cc4cc5c(N)nccc5cc4OC)C3=O)cc2c1
Standard InChI: InChI=1S/C26H26N4O5S/c1-34-20-5-3-16-4-6-21(12-18(16)11-20)36(32,33)29-23-8-10-30(26(23)31)15-19-13-22-17(14-24(19)35-2)7-9-28-25(22)27/h3-7,9,11-14,23,29H,8,10,15H2,1-2H3,(H2,27,28)/t23-/m0/s1
Standard InChI Key: RTZPSFNQGNYELJ-QHCPKHFHSA-N
Molfile:
RDKit 2D
36 40 0 0 1 0 0 0 0 0999 V2000
3.5042 -0.8167 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.4542 -0.8167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -0.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4792 -0.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9792 -0.5167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4292 -0.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0167 -0.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5958 -0.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0833 -0.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9417 -0.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1083 -0.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4292 -1.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5958 -1.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0292 -0.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4792 -1.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5167 -0.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1792 -1.4417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8042 -1.4792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0708 -1.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4542 -1.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6208 -0.8292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 0.0833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0292 0.0708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5542 -0.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0167 0.0708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5167 0.3708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5417 0.3708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1208 0.0708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0667 -0.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6208 -1.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9417 -1.7042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0542 0.0833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1083 -1.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5667 -0.8042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9417 -2.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5667 -1.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 1 1
5 1 1 0
6 10 1 0
7 1 1 0
8 9 1 0
9 6 2 0
10 2 1 0
11 8 2 0
12 6 1 0
13 19 1 0
14 16 2 0
15 4 1 0
16 7 1 0
17 1 2 0
18 1 2 0
19 12 2 0
20 15 1 0
21 11 1 0
22 3 2 0
23 26 2 0
24 14 1 0
25 7 2 0
26 25 1 0
27 23 1 0
28 11 1 0
29 24 2 0
30 33 1 0
31 12 1 0
32 27 2 0
33 13 2 0
34 29 1 0
35 31 1 0
36 34 1 0
14 23 1 0
2 20 1 0
29 32 1 0
13 8 1 0
21 30 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.58Molecular Weight (Monoisotopic): 506.1624AlogP: 3.07#Rotatable Bonds: 7Polar Surface Area: 123.85Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.04CX Basic pKa: 7.85CX LogP: 1.96CX LogD: 1.41Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.39Np Likeness Score: -0.72
References 1. Choi-Sledeski YM, Becker MR, Green DM, Davis R, Ewing WR, Mason HJ, Ly C, Spada A, Liang G, Cheney D, Barton J, Chu V, Brown K, Colussi D, Bentley R, Leadley R, Dunwiddie C, Pauls HW.. (1999) Aminoisoquinolines: design and synthesis of an orally active benzamidine isostere for the inhibition of factor XA., 9 (17): [PMID:10498204 ] [10.1016/s0960-894x(99)00421-7 ]