1-{4-[2-(5-Chloro-2,3-dioxo-2,3-dihydro-indol-1-yl)-acetyl]-piperazine-1-carbonyl}-3-naphthalen-1-yl-urea

ID: ALA315200

PubChem CID: 44462124

Max Phase: Preclinical

Molecular Formula: C26H22ClN5O5

Molecular Weight: 519.95

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NC(=O)N1CCN(C(=O)CN2C(=O)C(=O)c3cc(Cl)ccc32)CC1)Nc1cccc2ccccc12

Standard InChI:  InChI=1S/C26H22ClN5O5/c27-17-8-9-21-19(14-17)23(34)24(35)32(21)15-22(33)30-10-12-31(13-11-30)26(37)29-25(36)28-20-7-3-5-16-4-1-2-6-18(16)20/h1-9,14H,10-13,15H2,(H2,28,29,36,37)

Standard InChI Key:  IMBBHWNCXBMHDG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    0.8917  -10.7125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3875  -11.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1167  -11.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9042  -12.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1125  -10.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5292   -6.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2417   -6.0792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2417   -5.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1042   -9.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9000   -9.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5292   -7.3167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1042   -8.9042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9542   -4.8500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9500   -4.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6083  -10.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6083  -12.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2125  -11.3750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6542   -3.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1625  -12.8292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8125   -6.0792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7292   -7.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1125   -7.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5167   -8.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9000   -8.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5250   -4.8500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4792  -10.2792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3208  -11.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6542   -2.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3208  -10.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0333  -12.2167    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.2375   -3.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2375   -2.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3667   -4.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9417   -2.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3667   -2.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0792   -3.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0792   -2.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  5  1  0
  4  2  1  0
  5  1  1  0
  6 11  1  0
  7  6  1  0
  8  7  1  0
  9  1  1  0
 10  9  1  0
 11 22  1  0
 12 10  1  0
 13  8  1  0
 14 13  1  0
 15  5  2  0
 16  3  2  0
 17  2  2  0
 18 14  1  0
 19  4  2  0
 20  6  2  0
 21 23  1  0
 22 24  1  0
 23 12  1  0
 24 12  1  0
 25  8  2  0
 26 10  2  0
 27 29  2  0
 28 18  2  0
 29 15  1  0
 30 27  1  0
 31 14  2  0
 32 31  1  0
 33 18  1  0
 34 32  2  0
 35 28  1  0
 36 33  2  0
 37 36  1  0
  3  4  1  0
 16 27  1  0
 21 11  1  0
 28 34  1  0
 37 35  2  0
M  END

Associated Targets(Human)

CTRC Tchem Chymotrypsin C (381 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ELANE Tclin Leukocyte elastase (8173 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PLG Tclin Plasminogen (2339 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 519.95Molecular Weight (Monoisotopic): 519.1309AlogP: 3.11#Rotatable Bonds: 3
Polar Surface Area: 119.13Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.96CX Basic pKa: CX LogP: 2.16CX LogD: 2.16
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.52Np Likeness Score: -1.49

References

1. Shuttleworth SJ, Nasturica D, Gervais C, Siddiqui MA, Rando RF, Lee N..  (2000)  Parallel synthesis of isatin-based serine protease inhibitors.,  10  (22): [PMID:11086715] [10.1016/s0960-894x(00)00523-0]

Source