The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{4-[2-(5-Chloro-2,3-dioxo-2,3-dihydro-indol-1-yl)-acetyl]-piperazine-1-carbonyl}-3-naphthalen-1-yl-urea ID: ALA315200
PubChem CID: 44462124
Max Phase: Preclinical
Molecular Formula: C26H22ClN5O5
Molecular Weight: 519.95
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC(=O)N1CCN(C(=O)CN2C(=O)C(=O)c3cc(Cl)ccc32)CC1)Nc1cccc2ccccc12
Standard InChI: InChI=1S/C26H22ClN5O5/c27-17-8-9-21-19(14-17)23(34)24(35)32(21)15-22(33)30-10-12-31(13-11-30)26(37)29-25(36)28-20-7-3-5-16-4-1-2-6-18(16)20/h1-9,14H,10-13,15H2,(H2,28,29,36,37)
Standard InChI Key: IMBBHWNCXBMHDG-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
0.8917 -10.7125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3875 -11.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1167 -11.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9042 -12.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1125 -10.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5292 -6.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2417 -6.0792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2417 -5.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1042 -9.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9000 -9.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5292 -7.3167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1042 -8.9042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9542 -4.8500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9500 -4.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6083 -10.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6083 -12.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2125 -11.3750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6542 -3.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1625 -12.8292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8125 -6.0792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7292 -7.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1125 -7.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5167 -8.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9000 -8.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5250 -4.8500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4792 -10.2792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3208 -11.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6542 -2.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3208 -10.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0333 -12.2167 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.2375 -3.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2375 -2.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3667 -4.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9417 -2.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3667 -2.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0792 -3.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0792 -2.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 5 1 0
4 2 1 0
5 1 1 0
6 11 1 0
7 6 1 0
8 7 1 0
9 1 1 0
10 9 1 0
11 22 1 0
12 10 1 0
13 8 1 0
14 13 1 0
15 5 2 0
16 3 2 0
17 2 2 0
18 14 1 0
19 4 2 0
20 6 2 0
21 23 1 0
22 24 1 0
23 12 1 0
24 12 1 0
25 8 2 0
26 10 2 0
27 29 2 0
28 18 2 0
29 15 1 0
30 27 1 0
31 14 2 0
32 31 1 0
33 18 1 0
34 32 2 0
35 28 1 0
36 33 2 0
37 36 1 0
3 4 1 0
16 27 1 0
21 11 1 0
28 34 1 0
37 35 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.95Molecular Weight (Monoisotopic): 519.1309AlogP: 3.11#Rotatable Bonds: 3Polar Surface Area: 119.13Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.96CX Basic pKa: ┄CX LogP: 2.16CX LogD: 2.16Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.52Np Likeness Score: -1.49
References 1. Shuttleworth SJ, Nasturica D, Gervais C, Siddiqui MA, Rando RF, Lee N.. (2000) Parallel synthesis of isatin-based serine protease inhibitors., 10 (22): [PMID:11086715 ] [10.1016/s0960-894x(00)00523-0 ]