The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-Chloro-1-oxo-3-phenyl-1H-indene-2-carboxylic acid methyl ester; compound with 6-chloro-1-oxo-3-phenyl-1H-indene-2-carboxylic acid methyl ester ID: ALA316556
PubChem CID: 44330126
Max Phase: Preclinical
Molecular Formula: C34H22Cl2O6
Molecular Weight: 597.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C1=C(c2ccccc2)c2cc(Cl)ccc2C1=O.COC(=O)C1=C(c2ccccc2)c2ccc(Cl)cc2C1=O
Standard InChI: InChI=1S/2C17H11ClO3/c1-21-17(20)15-14(10-5-3-2-4-6-10)13-9-11(18)7-8-12(13)16(15)19;1-21-17(20)15-14(10-5-3-2-4-6-10)12-8-7-11(18)9-13(12)16(15)19/h2*2-9H,1H3
Standard InChI Key: QSCANXICFWJNLA-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
3.9542 -3.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4667 -4.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4667 -2.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6875 -4.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6875 -3.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7792 -3.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -2.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7292 -5.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0167 -4.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7250 -2.1792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1917 -2.9250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2542 -4.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2542 -3.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1917 -4.3542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5417 -4.4667 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.1750 -5.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5292 -5.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0167 -4.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7917 -6.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4292 -6.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2417 -6.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9792 -3.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4917 -4.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4917 -3.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7167 -4.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7167 -3.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8042 -3.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0417 -4.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7542 -5.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9917 -3.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7542 -2.5250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2167 -3.2667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2792 -3.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2792 -4.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2167 -4.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5667 -3.1625 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.5542 -5.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2042 -6.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0417 -4.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8167 -6.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4542 -6.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2667 -7.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 2 1 0
5 3 1 0
6 1 1 0
7 5 2 0
8 2 1 0
9 4 2 0
10 3 2 0
11 6 2 0
12 9 1 0
13 7 1 0
14 6 1 0
15 12 1 0
16 8 2 0
17 8 1 0
18 14 1 0
19 17 2 0
20 16 1 0
21 19 1 0
4 5 1 0
12 13 2 0
20 21 2 0
23 22 2 0
24 22 1 0
25 23 1 0
26 24 1 0
27 22 1 0
28 25 2 0
29 23 1 0
30 26 2 0
31 24 2 0
32 27 2 0
33 30 1 0
34 28 1 0
35 27 1 0
36 33 1 0
37 29 1 0
38 29 2 0
39 35 1 0
40 37 2 0
41 38 1 0
42 40 1 0
25 26 1 0
34 33 2 0
41 42 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 597.45Molecular Weight (Monoisotopic): 596.0793AlogP: ┄#Rotatable Bonds: ┄Polar Surface Area: ┄Molecular Species: ┄HBA: ┄HBD: ┄#RO5 Violations: ┄HBA (Lipinski): ┄HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: ┄CX LogD: ┄Aromatic Rings: ┄Heavy Atoms: ┄QED Weighted: ┄Np Likeness Score: ┄
References 1. Barvian M, Panek R, Lu G, Kraker A, Amar A, Hartl B, Hamby J, Showalter H. (1997) 1-Oxo-3-aryl-1H-indene-2-carboxylic acid derivatives as selective inhibitors of fibroblast growth factor receptor-1 tyrosine kinase, 7 (22): [10.1016/S0960-894X(97)10110-X ]