TROXERUTIN

ID: ALA3182320

Cas Number: 7085-55-4

PubChem CID: 5486699

Product Number: T101630, Order Now?

Max Phase: Phase

Molecular Formula: C33H42O19

Molecular Weight: 742.68

Molecule Type: Small molecule

Names and Identifiers

Synonyms: 3',4',7-tris(hydroxyethyl)rutin | Flavonoid | Trioxyethylrutin | Troxerutin | Vitamin p4 | NSC-758937 | THR | Z 6000 | Z-6000 | Troxerutin|7085-55-4|Posorutin|Troxerutine|Vitamin P4|Venoruton P4|Trihydroxyethylrutin|Trioxyethylrutin|3',4',7-Tris(hydroxyethyl)rutin|Factor P-zyma|Rufen-P4|Tris(hydroxyethyl)rutin|Tris(hydroxyethyl)rutoside|Troxerutin (INN)|Z 6000|Troxerutin (85%)|7Y4N11PXO8|DTXSID4045929|NSC-758937|2-(3,4-bis(2-hydroxyethoxy)phenyl)-5-hydroxy-7-(2-hydroxyethoxy)-3-(((2S,3R,4S,5S,6RShow More⌵

Canonical SMILES:  C[C@@H]1O[C@@H](OC[C@H]2O[C@@H](Oc3c(-c4ccc(OCCO)c(OCCO)c4)oc4cc(OCCO)cc(O)c4c3=O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O

Standard InChI:  InChI=1S/C33H42O19/c1-14-23(38)26(41)28(43)32(49-14)48-13-21-24(39)27(42)29(44)33(51-21)52-31-25(40)22-17(37)11-16(45-7-4-34)12-20(22)50-30(31)15-2-3-18(46-8-5-35)19(10-15)47-9-6-36/h2-3,10-12,14,21,23-24,26-29,32-39,41-44H,4-9,13H2,1H3/t14-,21+,23-,24+,26+,27-,28+,29+,32+,33-/m0/s1

Standard InChI Key:  IYVFNTXFRYQLRP-VVSTWUKXSA-N

Molfile:  

     RDKit          2D

 52 56  0  0  1  0  0  0  0  0999 V2000
   -0.3973    1.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3973    2.7089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3251    0.6449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0990    1.4705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0990    3.1216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0371    0.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8213    2.7089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8213    1.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8213   -3.0649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3251    1.4705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0371   -0.5882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5334   -3.4725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3973    0.2322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8213   -2.2342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3251   -0.9959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5334   -1.8265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3973   -0.5882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2454   -3.0649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3251    3.1216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2454   -2.2342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5334    3.1216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0371    2.7089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5334    1.4705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7543    3.1216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0990   -1.8265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0990    0.6449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0990   -0.9959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7543    3.9420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3251    3.9420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0371    4.3599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7543    0.6449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0990   -3.4725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7543   -0.9959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5334   -4.2929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2454    2.7089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3251   -1.8265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9627   -3.4725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2454    1.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4664    2.7089    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4664    4.3599    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9627    3.1216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9627   -1.8265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6025    3.1216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6025    3.9420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9627    1.4705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8905    4.3599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8905    2.7089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6695    1.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1784    3.1216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1784    3.9420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6695    2.7089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5334    0.6455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3 10  1  1
  4  1  1  0
  5  2  1  0
  6  3  1  0
  7  8  2  0
  8  4  1  0
  9 14  1  0
 10  1  1  0
 11  6  1  0
 12  9  1  0
 13  3  1  0
 14 25  1  1
 15 17  1  0
 16 14  1  0
 17 13  1  0
 18 20  1  0
 19  2  1  0
 20 16  1  0
 21  7  1  0
 22 19  1  0
 23  8  1  0
 24 22  2  0
 25 27  1  0
 26  4  2  0
 17 27  1  1
 28 30  2  0
 29 19  2  0
 30 29  1  0
  6 31  1  6
  9 32  1  6
 11 33  1  1
 12 34  1  6
 35 38  1  0
 15 36  1  6
 18 37  1  1
 38 23  2  0
 39 24  1  0
 40 28  1  0
 41 35  1  0
 20 42  1  6
 43 47  1  0
 44 46  1  0
 45 48  1  0
 46 50  1  0
 47 49  1  0
 48 51  1  0
 49 39  1  0
 50 40  1  0
 51 41  1  0
  5  7  1  0
 11 15  1  0
 21 35  2  0
 24 28  1  0
 12 18  1  0
 23 52  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA3182320

   Trihydroxyethylrutin

Molecule Features

Natural Product: Yes

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: Yes

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 742.68

Molecular Weight (Monoisotopic): 742.2320

AlogP: -2.69

#Rotatable Bonds: 15

Polar Surface Area: 297.12

Molecular Species: NEUTRAL

HBA: 19

HBD: 10

#RO5 Violations: 3

HBA (Lipinski): 19

HBD (Lipinski): 10

#RO5 Violations (Lipinski): 3

CX Acidic pKa: 7.14

CX Basic pKa: ┄

CX LogP: -2.50

CX LogD: -2.94

Aromatic Rings: 3

Heavy Atoms: 52

QED Weighted: 0.08

Np Likeness Score: 1.42

References

1. USP Dictionary of USAN and International Names (2010 edition) and USAN registrations 2007-date, 

2. De Bruyn T, van Westen GJ, Ijzerman AP, Stieger B, de Witte P, Augustijns PF, Annaert PP..  (2013)  Structure-based identification of OATP1B1/3 inhibitors.,  83  (6): [PMID:23571415] [10.1124/mol.112.084152]

3. PubChem BioAssay data set, 

4. WHO Anatomical Therapeutic Chemical Classification, 

5. Unpublished dataset, 

6. Bernhard Ellinger, Denisa Bojkova, Andrea Zaliani, Jindrich Cinatl, Carsten Claussen, Sandra Westhaus, Jeanette Reinshagen, Maria Kuzikov, Markus Wolf, Gerd Geisslinger, Philip Gribbon, Sandra Ciesek.  (2020)  Identification of inhibitors of SARS-CoV-2 in-vitro cellular toxicity in human (Caco-2) cells using a large scale drug repurposing collection,  [10.21203/rs.3.rs-23951/v1]

7. Maria Kuzikov, Elisa Costanzi, Jeanette Reinshagen, Francesca Esposito, Laura Vangeel, Markus Wolf, Bernhard Ellinger, Carsten Claussen, Gerd Geisslinger, Angela Corona, Daniela Iaconis, Carmine Talarico, Candida Manelfi, Rolando Cannalire, Giulia Rossetti, Jonas Gossen, Simone Albani, Francesco Musiani, Katja Herzog, Yang Ye, Barbara Giabbai, Nicola Demitri, Dirk Jochmans, Steven De Jonghe, Jasper Rymenants, Vincenzo Summa, Enzo Tramontano, Andrea R. Beccari, Pieter Leyssen, Paola Storici, Johan Neyts, Philip Gribbon, and Andrea Zaliani.  (2020)  Identification of inhibitors of SARS-Cov2 M-Pro enzymatic activity using a small molecule repurposing screen,  [10.6019/CHEMBL4495564]

8. Andrea Zaliani, Laura Vangeel, Jeanette Reinshagen, Daniela Iaconis, Maria Kuzikov, Oliver Keminer, Markus Wolf, Bernhard Ellinger, Francesca Esposito, Angela Corona, Enzo Tramontano, Candida Manelfi, Katja Herzog, Dirk Jochmans, Steven De Jonghe, Winston Chiu, Thibault Francken, Joost Schepers, Caroline Collard, Kayvan Abbasi, Carsten Claussen , Vincenzo Summa, Andrea R. Beccari, Johan Neyts, Philip Gribbon and Pieter Leyssen.  (2020)  Cytopathic SARS-Cov2 screening on VERO-E6 cells in a large repurposing effort,  [10.6019/CHEMBL4495565]

9. Sutherland JJ, Yonchev D, Fekete A, Urban L..  (2023)  A preclinical secondary pharmacology resource illuminates target-adverse drug reaction associations of marketed drugs.,  14  (1): [PMID:37468498] [10.1038/s41467-023-40064-9]

Source

Source(6):

• Scientific Literature
• PubChem BioAssays
• Clinical Candidates
• USP Dictionary of USAN and International Drug Names
• WHO Anatomical Therapeutic Chemical Classification
• SARS-CoV-2 Screening Data 2020-21