SID131464433

ID: ALA3183159

PubChem CID: 54668920

Max Phase: Preclinical

Molecular Formula: C31H32N2O2

Molecular Weight: 464.61

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Cc1ccccc1)N1CCCCN2[C@H](CO)[C@@H](c3ccc(C#Cc4ccccc4)cc3)[C@H]2C1

Standard InChI:  InChI=1S/C31H32N2O2/c34-23-29-31(27-17-15-25(16-18-27)14-13-24-9-3-1-4-10-24)28-22-32(19-7-8-20-33(28)29)30(35)21-26-11-5-2-6-12-26/h1-6,9-12,15-18,28-29,31,34H,7-8,19-23H2/t28-,29-,31+/m1/s1

Standard InChI Key:  WYEAORYGKBQIID-XQKNLLDYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  1  0  0  0  0  0999 V2000
    0.2135   -2.7886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9504    0.8699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4084   -1.4084    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8167    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5834   -0.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4084   -0.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5834   -1.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9917    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9917   -1.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7969   -0.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2135    0.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8167   -1.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1324    0.7622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4001   -0.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3803    0.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3698    1.3803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1667    1.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4001   -1.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6302    1.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7501    1.7501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9459    2.1789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3335    2.3335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4437    2.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7639    2.2866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9168    2.9168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7594    3.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0796    3.0488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5774    3.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7137    2.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7033    3.7137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2971    3.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2867    4.2971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0835    4.0835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 11  1  0
  2 15  2  0
  6  3  1  1
  3  7  1  0
  3 10  1  0
  4  9  1  0
  4 15  1  0
  4 16  1  0
  5  6  1  0
  5  7  1  0
  5  8  1  1
  6  9  1  0
  7 11  1  6
  8 12  2  0
  8 13  1  0
 10 14  1  0
 12 17  1  0
 13 18  2  0
 14 20  1  0
 15 21  1  0
 16 20  1  0
 17 19  2  0
 18 19  1  0
 19 22  1  0
 21 23  1  0
 22 24  3  0
 23 25  2  0
 23 26  1  0
 24 27  1  0
 25 28  1  0
 26 29  2  0
 27 31  2  0
 27 32  1  0
 28 30  2  0
 29 30  1  0
 31 33  1  0
 32 34  2  0
 33 35  2  0
 34 35  1  0
M  END

Associated Targets(Human)

CASP6 Tchem Caspase-6 (1213 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 464.61Molecular Weight (Monoisotopic): 464.2464AlogP: 4.08#Rotatable Bonds: 4
Polar Surface Area: 43.78Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.63CX LogP: 4.73CX LogD: 3.48
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.59Np Likeness Score: -0.34

References

1. PubChem BioAssay data set, 

Source

Source(1):