SID121284166

ID: ALA3183421

PubChem CID: 51359693

Max Phase: Preclinical

Molecular Formula: C27H32N2O3S

Molecular Weight: 464.63

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccccc1CN1[C@@H](C)[C@H](c2ccccc2)Oc2cccc(NCC(C)C)c2S1(=O)=O

Standard InChI:  InChI=1S/C27H32N2O3S/c1-19(2)17-28-24-15-10-16-25-27(24)33(30,31)29(18-23-14-9-8-11-20(23)3)21(4)26(32-25)22-12-6-5-7-13-22/h5-16,19,21,26,28H,17-18H2,1-4H3/t21-,26+/m0/s1

Standard InChI Key:  JNJFGPBMJSRAAW-HFZDXXHNSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  1  0  0  0  0  0999 V2000
    0.7805    1.6880    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.7442   -1.6517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4036    1.8829    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5828    2.5804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2507    1.3976    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5580    3.0236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9404    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2325   -1.4158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4884    1.5247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1520    2.5995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1193   -2.6265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4884   -1.5247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8315    0.7623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6422    2.4214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8315   -0.7623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1404   -0.0031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6070   -2.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5626   -4.0187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5438    3.6202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2298    1.0412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8911    3.7130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5326   -3.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4882   -5.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0328    3.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7188    0.8599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9732   -4.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9616    5.2122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6203    2.0588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0738    4.7244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0275    5.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9514    5.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  3  2  0
  1  4  2  0
  1  5  1  0
  1  7  1  0
  2  8  1  0
  2 10  1  0
  5  9  1  0
  5 12  1  0
  6 11  1  0
  6 23  1  0
  7  8  2  0
  7 11  1  0
  8 14  1  0
  9 10  1  0
  9 18  1  1
 10 13  1  6
 11 15  2  0
 12 16  1  0
 13 19  2  0
 13 20  1  0
 14 17  2  0
 15 17  1  0
 16 21  1  0
 16 22  2  0
 19 24  1  0
 20 25  2  0
 21 26  2  0
 21 31  1  0
 22 27  1  0
 23 29  1  0
 24 28  2  0
 25 28  1  0
 26 30  1  0
 27 30  2  0
 29 32  1  0
 29 33  1  0
M  END

Associated Targets(Human)

CASP6 Tchem Caspase-6 (1213 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 464.63Molecular Weight (Monoisotopic): 464.2134AlogP: 5.78#Rotatable Bonds: 6
Polar Surface Area: 58.64Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.63CX LogP: 5.85CX LogD: 5.85
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -0.30

References

1. PubChem BioAssay data set, 

Source

Source(1):